CymitQuimica logo

CAS 279261-92-6

:

Boronic acid, [4-[(tetrahydro-2H-pyran-4-yl)oxy]phenyl]-

Description:
Boronic acid, specifically 4-[(tetrahydro-2H-pyran-4-yl)oxy]phenyl- (CAS 279261-92-6), is an organic compound characterized by the presence of a boronic acid functional group attached to a phenyl ring. This compound features a tetrahydro-2H-pyran moiety, which contributes to its structural complexity and potential reactivity. Boronic acids are known for their ability to form reversible covalent bonds with diols, making them valuable in various applications, including organic synthesis and medicinal chemistry. The presence of the tetrahydro-2H-pyran group may enhance solubility and stability in certain solvents, while also influencing the compound's biological activity. Typically, boronic acids exhibit moderate to high polarity due to the presence of the boron atom and hydroxyl group, which can participate in hydrogen bonding. This compound may also serve as a building block in the synthesis of more complex molecules, particularly in the development of pharmaceuticals and agrochemicals. Overall, its unique structure and functional properties make it a significant compound in chemical research and applications.
Formula:C11H15BO4
InChI:InChI=1S/C11H15BO4/c13-12(14)9-1-3-10(4-2-9)16-11-5-7-15-8-6-11/h1-4,11,13-14H,5-8H2
InChI key:REFMZRSECYWYKZ-UHFFFAOYSA-N
SMILES:B(C1=CC=C(C=C1)OC2CCOCC2)(O)O
Found 5 products.