CAS 279263-03-5

5-Bromo-2-ethoxybenzonitrile

Description:

5-Bromo-2-ethoxybenzonitrile is an organic compound characterized by its aromatic structure, which includes a bromine atom and an ethoxy group attached to a benzonitrile framework. The presence of the bromine substituent typically enhances the compound's reactivity, making it useful in various synthetic applications, particularly in medicinal chemistry and material science. The ethoxy group contributes to the compound's solubility in organic solvents and can influence its electronic properties. As a nitrile, it features a cyano group (-C≡N), which is known for its ability to participate in nucleophilic reactions and can serve as a versatile functional group in organic synthesis. The compound is likely to be a solid at room temperature and may exhibit moderate to low toxicity, necessitating standard safety precautions during handling. Its specific applications may include serving as an intermediate in the synthesis of pharmaceuticals or agrochemicals, as well as in the development of novel materials.

Formula: C₉H₈BrNO

InChI: InChI=1/C9H8BrNO/c1-2-12-9-4-3-8(10)5-7(9)6-11/h3-5H,2H2,1H3

SMILES: CCOc1ccc(cc1C#N)Br

Synonyms:

• Benzonitrile, 5-Bromo-2-Ethoxy-

5-Bromo-2-ethoxybenzonitrile

CAS: 279263-03-5

Formula: C₉H₈BrNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 226.0699

Ref: IN-DA003MGW

5-Bromo-2-ethoxybenzonitrile

CAS: 279263-03-5

5-Bromo-2-ethoxybenzonitrile

Purity: 98%

Molecular weight: 226.07g/mol

Ref: 54-OR94748

5-bromo-2-ethoxybenzonitrile

CAS: 279263-03-5

Formula: C₉H₈BrNO

Purity: 98%

Molecular weight: 226.073

Ref: 10-F367529