CAS 27932-76-9
:N-(ethoxycarbonyl)-L-histidine
Description:
N-(ethoxycarbonyl)-L-histidine, with the CAS number 27932-76-9, is a derivative of the amino acid histidine, characterized by the presence of an ethoxycarbonyl group attached to the nitrogen of the imidazole side chain. This modification enhances its solubility and stability compared to unmodified histidine. The compound typically exhibits properties associated with amino acids, including the ability to participate in peptide bond formation and act as a zwitterion at physiological pH. Its structure allows for potential applications in biochemistry and pharmaceuticals, particularly in the synthesis of peptide-based drugs or as a building block in organic synthesis. The ethoxycarbonyl group can also influence the compound's reactivity and interaction with other biomolecules. Additionally, N-(ethoxycarbonyl)-L-histidine may exhibit specific biological activities, making it of interest in research related to enzyme catalysis and drug design. As with many amino acid derivatives, its stability and reactivity can be influenced by environmental factors such as pH and temperature.
Formula:C9H13N3O4
InChI:InChI=1/C9H13N3O4/c1-2-16-9(15)12-7(8(13)14)3-6-4-10-5-11-6/h4-5,7H,2-3H2,1H3,(H,10,11)(H,12,15)(H,13,14)
Synonyms:- L-Histidine, N-(ethoxycarbonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-Carbethoxyhistidine
CAS:<p>N-Carbethoxyhistidine can be used to protect amine functional groups.</p>Formula:C9H13N3O4Color and Shape:SolidMolecular weight:227.22
