CAS 27934-98-1

Ipolamiide

Description:

Ipolamiide, with the CAS number 27934-98-1, is a chemical compound that belongs to the class of amides. It is characterized by its structural features, which typically include an amide functional group (-CONH-) linked to a hydrocarbon chain. This compound is known for its potential applications in various fields, including pharmaceuticals and materials science. Ipolamiide may exhibit properties such as solubility in organic solvents, thermal stability, and specific reactivity patterns typical of amides. Its molecular structure can influence its physical and chemical properties, such as melting point, boiling point, and reactivity with other chemical species. Additionally, the presence of functional groups can impart biological activity, making it of interest in medicinal chemistry. As with many chemical substances, safety data and handling precautions are essential for its use in laboratory and industrial settings. For detailed information on its specific characteristics, including toxicity and environmental impact, consulting safety data sheets and scientific literature is recommended.

Formula: C₁₇H₂₆O₁₁

InChI: InChI=1S/C17H26O11/c1-16(23)3-4-17(24)7(13(22)25-2)6-26-15(12(16)17)28-14-11(21)10(20)9(19)8(5-18)27-14/h6,8-12,14-15,18-21,23-24H,3-5H2,1-2H3/t8-,9-,10+,11-,12-,14+,15+,16+,17+/m1/s1

InChI key: InChIKey=RWMXKBUPLSNIJL-BHBNKKJBSA-N

SMILES: O[C@]12[C@]([C@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)OC=C1C(OC)=O)([C@@](C)(O)CC2)[H]

Synonyms:

• Cyclopenta[c]pyran-4-carboxylic acid, 1-(β-D-glucopyranosyloxy)-1,4a,5,6,7,7a-hexahydro-4a,7-dihydroxy-7-methyl-, methyl ester, [1S-(1α,4aα,7α,7aα)]-
• Cyclopenta[c]pyran-4-carboxylic acid, 1-(β-D-glucopyranosyloxy)-1,4a,5,6,7,7a-hexahydro-4a,7-dihydroxy-7-methyl-, methyl ester, (1S,4aR,7S,7aR)-
• Ipolamiide
• Tarphetalin

Ipolamiide

CAS: 27934-98-1

Formula: C₁₇H₂₆O₁₁

Molecular weight: 406.38

Ref: 4Z-I-150001