CAS 27942-64-9
:Benzoicacidchlorobutylester; 98%
Description:
Benzoic acid chlorobutyl ester, with the CAS number 27942-64-9, is an organic compound characterized by its ester functional group, which is formed from the reaction of benzoic acid and chlorobutanol. This compound typically appears as a colorless to pale yellow liquid with a distinctive aromatic odor. It is moderately soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The presence of the chlorobutyl group imparts certain reactivity, making it useful in various chemical applications, including as an intermediate in organic synthesis and in the production of pharmaceuticals and agrochemicals. Safety considerations are important, as it may be harmful if inhaled or ingested, and appropriate handling procedures should be followed to minimize exposure. Additionally, it may undergo hydrolysis in the presence of water, leading to the release of benzoic acid and chlorobutanol. Overall, benzoic acid chlorobutyl ester is a versatile compound with applications in both industrial and research settings.
Formula:C11H13ClO2
InChI:InChI=1/C11H13ClO2/c1-2-3-8-14-11(13)9-4-6-10(12)7-5-9/h4-7H,2-3,8H2,1H3
SMILES:CCCCOC(=O)c1ccc(cc1)Cl
Synonyms:- Benzoic acid 4-chloro-n-butyl ester
- Butyl 4-Chlorobenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Butyl 4-chlorobenzoate
CAS:Butyl 4-chlorobenzoate is an organic compound that has a radical chain mechanism of action. It is used as a photosensitizer in photodynamic therapy and can be activated by ultraviolet light. The radical species generated by this drug attacks the DNA of the bacteria, leading to cell death. One of the key steps in the process is the transfer of a hydrogen atom from butyl 4-chlorobenzoate to an electron donor, such as hydroxyanisole, followed by irradiation with light to generate radical species. Butyl 4-chlorobenzoate also inhibits bacterial growth through its ability to act as an acid and cause acidic pH changes within cells.Formula:C11H13ClO2Purity:Min. 95%Molecular weight:212.67 g/mol
