CymitQuimica logo

CAS 2795-63-3

:

2-(4-Fluorophenoxy)benzoic acid

Description:
2-(4-Fluorophenoxy)benzoic acid, with the CAS number 2795-63-3, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety and a fluorophenoxy group. This compound features a fluorine atom substituted on the para position of the phenyl ring, which can influence its chemical reactivity and biological activity. It is typically a white to off-white solid at room temperature and is soluble in organic solvents, but its solubility in water is limited due to the hydrophobic nature of the aromatic rings. The presence of the carboxylic acid functional group (-COOH) allows for potential hydrogen bonding and contributes to its acidity. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in pharmaceuticals and as an intermediate in organic synthesis. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on purity and environmental conditions. Safety data should be consulted for handling and storage guidelines.
Formula:C13H9FO3
InChI:InChI=1S/C13H9FO3/c14-9-5-7-10(8-6-9)17-12-4-2-1-3-11(12)13(15)16/h1-8H,(H,15,16)
InChI key:InChIKey=WRWUSRADWXKZGV-UHFFFAOYSA-N
SMILES:O(C1=C(C(O)=O)C=CC=C1)C2=CC=C(F)C=C2
Synonyms:
  • Benzoic acid, o-(p-fluorophenoxy)-
  • Benzoic acid, 2-(4-fluorophenoxy)-
  • 2-(4-Fluorophenoxy)benzoic acid
Found 3 products.