CAS 27951-69-5

3,3',5,5'-tetrabromobiphenyl-2,2',4,4'-tetrol

Description:

3,3',5,5'-Tetrabromobiphenyl-2,2',4,4'-tetrol, with CAS number 27951-69-5, is a polybrominated biphenyl compound characterized by the presence of four bromine atoms and two hydroxyl groups on its biphenyl structure. This compound is part of a larger class of brominated flame retardants, which are known for their effectiveness in reducing flammability in various materials. The presence of multiple bromine atoms contributes to its hydrophobic nature and potential bioaccumulation in the environment. The hydroxyl groups introduce polar characteristics, which may influence its solubility and reactivity. Due to its structural features, this compound may exhibit significant environmental persistence and potential toxicity, raising concerns regarding its impact on human health and ecosystems. Research into its behavior, degradation pathways, and effects on living organisms is ongoing, as regulatory scrutiny increases for such substances. Overall, 3,3',5,5'-tetrabromobiphenyl-2,2',4,4'-tetrol exemplifies the complexities associated with the use of brominated compounds in industrial applications.

Formula: C₁₂H₆Br₄O₄

InChI: InChI=1/C12H6Br4O4/c13-5-1-3(9(17)7(15)11(5)19)4-2-6(14)12(20)8(16)10(4)18/h1-2,17-20H

SMILES: c1c(c2cc(c(c(c2O)Br)O)Br)c(c(c(c1Br)O)Br)O

Synonyms:

• [1,1'-Biphenyl]-2,2',4,4'-Tetrol, 3,3',5,5'-Tetrabromo-

Tebrofen

CAS: 27951-69-5

Tebrofen is a polyphenol drug, it has antiviral and anticancer properties.

Formula: C₁₂H₆Br₄O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 533.79

Ref: TM-T28936