CAS 27963-97-9

2-amino-5-(hydroxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]oxazol-6-ol

Description:

2-amino-5-(hydroxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]oxazol-6-ol, with CAS number 27963-97-9, is a heterocyclic organic compound characterized by its complex bicyclic structure that includes both furan and oxazole rings. This compound features an amino group and a hydroxymethyl group, which contribute to its reactivity and potential biological activity. The presence of these functional groups suggests that it may participate in hydrogen bonding and other interactions, making it of interest in medicinal chemistry. The tetrahydrofuro structure indicates that it is a saturated derivative, which can influence its stability and solubility in various solvents. Additionally, the compound's unique arrangement of atoms may impart specific properties, such as chirality, which can affect its interaction with biological systems. Overall, this compound's structural features suggest potential applications in pharmaceuticals or as a biochemical probe, although further studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₆H₁₀N₂O₄

InChI: InChI=1/C6H8N2O3.H2O/c9-5(6(10)11)1-4-2-7-3-8-4;/h2-3,5,9H,1H2,(H,7,8)(H,10,11);1H2/t5-;/m0./s1

SMILES: C(c1cnc[nH]1)[C@@H](C(=O)O)O.O

Synonyms:

• (2S)-2-hydroxy-3-(1H-imidazol-5-yl)propanoic acid hydrate

2-Amino-a-D-ribofurano[1',2':4,5]oxazoline

CAS: 27963-97-9

2-Amino-a-D-ribofurano[1',2':4,5]oxazoline is a modified ribose analogue

Formula: C₅H₁₀N₂O₄

Purity: Min. 95%

Molecular weight: 162.2 g/mol

Ref: 3D-MA01170