CAS 27963-98-0
:2-amino-5-(hydroxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]oxazol-6-ol
Description:
2-amino-5-(hydroxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]oxazol-6-ol, with the CAS number 27963-98-0, is a heterocyclic organic compound characterized by its complex bicyclic structure that includes both furan and oxazole rings. This compound features an amino group and a hydroxymethyl group, which contribute to its reactivity and potential biological activity. The presence of these functional groups suggests that it may participate in hydrogen bonding and other interactions, making it of interest in medicinal chemistry and drug development. Its tetrahydrofuro structure indicates that it is a saturated derivative, which may influence its stability and solubility in various solvents. The compound's unique structure may also impart specific properties such as chirality, which can affect its biological interactions. Overall, 2-amino-5-(hydroxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]oxazol-6-ol is a compound of interest for further research, particularly in the fields of organic synthesis and pharmacology.
Formula:C6H10N2O4
InChI:InChI=1/C6H8N2O3.H2O/c9-5(6(10)11)1-4-2-7-3-8-4;/h2-3,5,9H,1H2,(H,7,8)(H,10,11);1H2/t5-;/m0./s1
SMILES:C(c1cnc[nH]1)[C@@H](C(=O)O)O.O
Synonyms:- (2S)-2-hydroxy-3-(1H-imidazol-5-yl)propanoic acid hydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
O,N-Aminomethanylylidene-beta-D-arabinofuranose
CAS:Controlled ProductApplications O,N-Aminomethanylylidene-β-D-arabinofuranose (cas# 27963-98-0) is a compound useful in organic synthesis.
Formula:C6H10N2O4Color and Shape:NeatMolecular weight:174.152-Amino-β-D-arabinofurano[1,2;4,5]oxazoline
CAS:2-Amino-b-D-arabinofurano[1,2;4,5]oxazoline is an organic compound that can be used in the synthesis of saccharides. It is also a fluorescent probe for amino acids and sugars. 2-Amino-b-D-arabinofurano[1,2;4,5]oxazoline has been shown to be a high purity product and can be custom synthesized. This compound is often used in glycosylation reactions with sugar or saccharide donors. The synthesis of 2-amino b D arabinofurano [1,2;4,5] oxazoline is not complicated and can be achieved by modifying the methyl group on the ring at C2 position. The CAS number for this compound is 27963-98-0.
Formula:C6H10N2O4Purity:Min. 95%Color and Shape:PowderMolecular weight:174.15 g/mol


