CAS 2797-28-6

Lithium tetrakis(pentafluorophenyl)borate diethylether complex

Description:

Lithium tetrakis(pentafluorophenyl)borate diethylether complex, with the CAS number 2797-28-6, is a lithium salt characterized by its unique structure and properties. This compound features a lithium cation coordinated to a tetrakis(pentafluorophenyl)borate anion, which consists of a boron atom bonded to four pentafluorophenyl groups. The presence of these highly electronegative fluorine atoms imparts significant stability and solubility in nonpolar solvents. The diethylether component serves as a coordinating solvent, enhancing the solubility and reactivity of the lithium salt. This complex is known for its use in various applications, including as an electrolyte in electrochemical cells and in organic synthesis as a reagent. Its high thermal stability and low volatility make it suitable for use in sensitive chemical processes. Additionally, the compound exhibits interesting electronic properties due to the presence of the pentafluorophenyl groups, which can influence the reactivity and selectivity in chemical reactions. Overall, lithium tetrakis(pentafluorophenyl)borate diethylether complex is a valuable compound in both academic and industrial chemistry.

Formula: C₂₄BF₂₀Li

InChI: InChI=1/C24BF20.Li/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;/q-1;+1

SMILES: c1(c(c(c(c(c1F)F)F)F)F)[B-](c1c(c(c(c(c1F)F)F)F)F)(c1c(c(c(c(c1F)F)F)F)F)c1c(c(c(c(c1F)F)F)F)F.[Li]

Synonyms:

• Lithium Tetrakis(Pentafluorophenyl)Borate(1-)

Tetrakis(pentafluorophenyl)-borate lithium (1:1)

Controlled Product

CAS: 2797-28-6

Tetrakis(pentafluorophenyl)-borate lithium (1:1) is a cocatalyst that is used for the dehydrogenation of ethylene to produce hexane. Tetrakis(pentafluorophenyl)-borate lithium (1:1) is a ligand that coordinates with magnesium oxide to form an ionic complex. It has been shown to activate the dehydrogenation of ethylene by providing chloride ions. The reaction mechanism of this process involves coordination of the magnesium ion with the borate ion, which leads to activation of the ethylene molecule and facilitates its conversion into hexane. Tetrakis(pentafluorophenyl)-borate lithium (1:1) coordinates with magnesium in a trigonal bipyramidal geometry, and has been shown to be more reactive than other borate cocatalysts such as tetrakis(perfluoroethyl)borate potassium (2:1).

Formula: C₃₂H₂₀BF₂₀LiO₂

Purity: Min. 95%

Molecular weight: 834.22 g/mol

Ref: 3D-FT90854