CAS 27972-89-0
:5-hydroxy-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]pyrimidine-2,4-dione; phosphoric acid
Description:
The chemical substance known as "5-hydroxy-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]pyrimidine-2,4-dione; phosphoric acid" with CAS number 27972-89-0 is a complex organic compound that features a pyrimidine ring substituted with hydroxyl groups and a tetrahydrofuran moiety. This compound is characterized by its multiple functional groups, including hydroxyl (-OH) and phosphate groups, which contribute to its solubility and reactivity in aqueous environments. The presence of stereocenters in the tetrahydrofuran ring indicates that this compound can exist in different stereoisomeric forms, which may influence its biological activity and interactions. It is often studied in the context of biochemistry and pharmacology, particularly for its potential roles in nucleic acid metabolism and as a biochemical precursor. The phosphoric acid component suggests that it may participate in phosphorylation reactions, which are crucial in various metabolic pathways. Overall, this compound exemplifies the intricate relationship between structure and function in organic chemistry and biochemistry.
Formula:C9H21N2O18P3
InChI:InChI=1/C9H12N2O6.3H3O4P/c12-3-6-4(13)1-7(17-6)11-2-5(14)8(15)10-9(11)16;3*1-5(2,3)4/h2,4,6-7,12-14H,1,3H2,(H,10,15,16);3*(H3,1,2,3,4)/t4-,6+,7+;;;/m0.../s1
Synonyms:- 2'-Deoxy-5-hydroxyuridine phosphate (1:3)
- Uridine, 2'-Deoxy-5-Hydroxy-, Phosphate (1:3) (Salt)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2'-Deoxy-5-hydroxyuridine 5'-triphosphate
CAS:2'-Deoxy-5-hydroxyuridine 5'-triphosphate (doxorubicin) is a cytotoxic and chemotherapeutic agent that interferes with DNA replication. It is an oxidized form of the natural pyrimidine base thymine. The drug blocks DNA synthesis by preventing the incorporation of uracil into the newly synthesized strand, which causes strand breaks. Doxorubicin has been shown to be effective in treating a variety of cancers, including those of the breast, ovaries, bladder, and stomach. This drug can also cause severe side effects such as heart damage and hearing loss due to its interaction with cellular oxygen metabolism.Purity:Min. 95%
