CAS 27973-29-1
:1,6-Dibromopyrene
Description:
1,6-Dibromopyrene is a polycyclic aromatic hydrocarbon characterized by the presence of two bromine atoms attached to the pyrene structure at the 1 and 6 positions. This compound typically appears as a solid, exhibiting a crystalline form with a relatively high melting point. It is known for its hydrophobic nature, making it poorly soluble in water but more soluble in organic solvents such as dichloromethane and acetone. The presence of bromine atoms enhances its reactivity, particularly in electrophilic substitution reactions, and can influence its photophysical properties, including fluorescence. 1,6-Dibromopyrene is of interest in various fields, including materials science and organic electronics, due to its potential applications in organic semiconductors and as a building block for more complex molecular architectures. Additionally, like many polycyclic aromatic hydrocarbons, it may pose environmental and health risks, necessitating careful handling and assessment of its toxicity and environmental impact.
Formula:C16H8Br2
InChI:InChI=1/C16H8Br2/c17-13-8-4-10-2-6-12-14(18)7-3-9-1-5-11(13)16(10)15(9)12/h1-8H
SMILES:c1cc2c(ccc3ccc4c(ccc1c4c23)Br)Br
Synonyms:- L666 B6 2Ab Pj Ge Ne [Wln]
- Pyrene, 1,6-Dibromo-
- 1,6-Dibrornopyrone
- K0034
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1,6-Dibromopyrene
CAS:Formula:C16H8Br2Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:360.051,6-Dibromopyrene
CAS:1,6-DibromopyreneFormula:C16H8Br2Purity:98%Color and Shape: white crystalline solidMolecular weight:360.04g/mol1,6-Dibromopyrene
CAS:1,6-Dibromopyrene is a pollutant that has been found in wastewater. It can be detected by fluorescence properties and is also used as an optical sensor. 1,6-Dibromopyrene can be synthesized from the Suzuki coupling reaction of benzene with bromine or phosphorus pentabromide. This compound has been studied extensively and has been shown to emit light when reacting with oxygen or other oxidizing agents. The molecule of 1,6-dibromopyrene contains both acidic and basic functional groups and can undergo cross-coupling reactions with various metal ions to produce a variety of products.Formula:C16H8Br2Purity:Min. 95%Color and Shape:White PowderMolecular weight:360.04 g/mol1,6-Dibromopyrene
CAS:Formula:C16H8Br2Purity:98%Color and Shape:Solid, Off-white powderMolecular weight:360.0481,6-Dibromopyrene
CAS:Controlled ProductApplications 1,6-Dibromopyrene
Formula:C16H8Br2Color and Shape:NeatMolecular weight:360.04





