CAS 27976-27-8
:1-Bromo-6-phenylhexane
Description:
1-Bromo-6-phenylhexane is an organic compound characterized by the presence of a bromine atom attached to a hexane chain, specifically at the sixth carbon, and a phenyl group at the same position. This compound belongs to the class of alkyl halides, where the bromine atom serves as a leaving group in nucleophilic substitution reactions. It typically appears as a colorless to pale yellow liquid with a moderate boiling point, indicative of its molecular weight and structure. The presence of the phenyl group contributes to its aromatic characteristics, influencing its reactivity and solubility in organic solvents. 1-Bromo-6-phenylhexane can participate in various chemical reactions, including substitution and elimination reactions, making it useful in organic synthesis. Its properties, such as density and refractive index, are influenced by the bromine and phenyl substituents. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of bromine, which is toxic and can cause irritation.
Formula:C12H17Br
InChI:InChI=1/C12H17Br/c13-11-7-2-1-4-8-12-9-5-3-6-10-12/h3,5-6,9-10H,1-2,4,7-8,11H2
SMILES:C(CCCBr)CCc1ccccc1
Synonyms:- 6-Phenyl-n-hexyl bromide
- (6-Bromohexyl)Benzene
- 1-(6-Bromohexyl)benzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Bromo-6-phenylhexane, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C12H17BrPurity:97%Color and Shape:Liquid, Clear colorlessMolecular weight:241.17(6-Bromohex-1-yl)benzene
CAS:(6-Bromohex-1-yl)benzeneFormula:C12H17BrPurity:97%Color and Shape: colourless liquidMolecular weight:241.17g/mol
