CAS 2798-20-1
:Gardenin B
Description:
Gardenin B, with the CAS number 2798-20-1, is a natural compound classified as a flavonoid, specifically a type of polyphenolic compound. It is primarily derived from various plant sources, particularly those in the genus Gardenia. This compound is known for its potential biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties. Gardenin B exhibits a complex structure characterized by multiple hydroxyl groups, which contribute to its reactivity and interaction with biological systems. Its solubility in organic solvents and limited solubility in water are typical for flavonoids, influencing its bioavailability and efficacy in pharmacological applications. Research into Gardenin B has highlighted its potential therapeutic benefits, although further studies are necessary to fully elucidate its mechanisms of action and potential uses in medicine and health. As with many natural compounds, the extraction and purification processes can significantly affect its yield and activity, making standardization important for research and application.
Formula:C19H18O7
InChI:InChI=1S/C19H18O7/c1-22-11-7-5-10(6-8-11)13-9-12(20)14-15(21)17(23-2)19(25-4)18(24-3)16(14)26-13/h5-9,21H,1-4H3
InChI key:InChIKey=LXEVSYZNYDZSOB-UHFFFAOYSA-N
SMILES:OC1=C2C(=C(OC)C(OC)=C1OC)OC(=CC2=O)C3=CC=C(OC)C=C3
Synonyms:- 4H-1-benzopyran-4-one, 5-hydroxy-6,7,8-trimethoxy-2-(4-methoxyphenyl)-
- 5-Demethyltangeretin
- 5-Desmethyltangeretin
- 5-Hydroxy-2-(4-methoxyphenyl)-6,7,8-trimethoxy-4H-1-benzopyran-4-one
- 5-Hydroxy-4',6,7,8-tetramethoxyflavone
- 5-Hydroxy-4′,6,7,8-tetramethoxyflavone
- 5-Hydroxy-6,7,8,4′-tetramethoxyflavone
- 5-Hydroxy-6,7,8-trimethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one
- 5-O-Desmethyltangeretin
- Demethyltangeretin
- Flavone, 5-hydroxy-4′,6,7,8-tetramethoxy-
- Gardenin B
- NSC 618926
- NSC 79093
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Gardenin B
CAS:Gardenin B exhibits superior antiproliferative activity against lung, breast, colon, hepatic and leukaemia cell lines as well as in keratinocytes .Formula:C19H18O7Purity:98.80% - 99.74%Color and Shape:SolidMolecular weight:358.34Gardenin b
CAS:Oxygen-heterocyclic compoundFormula:C19H18O7Purity:≥ 98.0 % (HPLC)Color and Shape:PowderMolecular weight:358.34Gardenin B
CAS:Gardenin B is a microbial biocontrol agent that originates from Streptomyces bacteria. It functions as a secondary metabolite deriving from its microbial source. The mode of action involves inhibiting the growth of plant-pathogenic fungi by disrupting their cellular processes and interfering with spore germination or hyphal proliferation. Gardenin B is primarily utilized in agricultural settings to control fungal diseases in crops, reducing reliance on synthetic chemical fungicides. Its application is integrated into plant protection programs to enhance agricultural sustainability and improve crop yields while minimizing the environmental impact. Scientists are investigating its mechanisms and potential for broader applications.Formula:C19H18O7Purity:Min. 95%Molecular weight:358.34 g/mol






