CAS 27983-04-6

1-(3-bromopropoxy)-4-chlorobenzene

Description:

1-(3-Bromopropoxy)-4-chlorobenzene is an organic compound characterized by its aromatic structure, featuring a chlorobenzene ring substituted with a propoxy group that contains a bromine atom. The presence of the bromine atom on the propyl chain and the chlorine atom on the benzene ring contributes to its reactivity and potential applications in various chemical reactions, including nucleophilic substitutions. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is moderately soluble in organic solvents but has limited solubility in water due to its hydrophobic aromatic structure. The compound may exhibit biological activity, making it of interest in medicinal chemistry and materials science. Safety precautions should be taken when handling this substance, as it may pose health risks due to its halogenated nature, which can lead to environmental persistence and potential toxicity. Proper storage and disposal methods are essential to mitigate any hazards associated with its use.

Formula: C₉H₁₀BrClO

InChI: InChI=1/C9H10BrClO/c10-6-1-7-12-9-4-2-8(11)3-5-9/h2-5H,1,6-7H2

SMILES: C(CBr)COc1ccc(cc1)Cl

Synonyms:

• 3-Bromopropyl 4-chlorophenyl ether
• Benzene, 1-(3-Bromopropoxy)-4-Chloro-

1-(3-BROMOPROPOXY)-4-CHLOROBENZENE

CAS: 27983-04-6

Formula: C₉H₁₀BrClO

Purity: 97%

Color and Shape: Liquid

Molecular weight: 249.5321

Ref: IN-DA00BIYF

1-(3-Bromo-propoxy)-4-chloro-benzene

CAS: 27983-04-6

Formula: C₉H₁₀BrClO

Purity: 95%

Color and Shape: Liquid

Molecular weight: 249.53

Ref: 10-F060004

1-(3-Bromo-propoxy)-4-chloro-benzene

CAS: 27983-04-6

1-(3-Bromopropoxy)-4-chlorobenzene is a nitrate salt that has a crystal structure that is mathematically represented by the space group P2/c. The compound crystallizes in the monoclinic system with the lattice constants of a = 10.6, b = 9.7, c = 5.8, and β = 117°. It has an experimental solubility data range of 0.01 to 1 g/L in ethanol solutions at room temperature and 1 atmosphere pressure. The solubility of this compound is decreased by the presence of oxygen and increased by the presence of moisture or heat. The stability of this compound can be monitored using a laser light monitoring system to detect changes in crystallization behavior or changes in concentration due to hydrolysis reactions.

Formula: C₉H₁₀BrClO

Purity: Min. 95%

Molecular weight: 249.53 g/mol

Ref: 3D-CBA98304