CAS 2799-86-2

N-benzyl-2-oxocyclopentanecarboxamide

Description:

N-benzyl-2-oxocyclopentanecarboxamide, with the CAS number 2799-86-2, is an organic compound characterized by its unique structural features. It contains a cyclopentanecarboxamide moiety, which is a five-membered cyclic structure with a carbonyl group (ketone) and an amide functional group. The presence of the benzyl group enhances its lipophilicity, potentially influencing its solubility and reactivity. This compound may exhibit various chemical properties, including the ability to participate in hydrogen bonding due to the amide group, which can affect its boiling and melting points. Additionally, the oxo group contributes to its reactivity, making it a potential candidate for further chemical transformations. N-benzyl-2-oxocyclopentanecarboxamide may be of interest in medicinal chemistry and material science due to its structural complexity and potential biological activity. However, specific applications and biological effects would require further investigation through experimental studies.

Formula: C₁₃H₁₅NO₂

InChI: InChI=1/C13H15NO2/c15-12-8-4-7-11(12)13(16)14-9-10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9H2,(H,14,16)

SMILES: c1ccc(cc1)CN=C(C1CCCC1=O)O

N-Benzyl-2-oxocyclopentanecarboxamide

CAS: 2799-86-2

Formula: C₁₃H₁₅NO₂

Purity: 95%

Molecular weight: 217.2637

Ref: IN-DA007LUM

N-Benzyl-2-oxocyclopentane-1-carboxamide

CAS: 2799-86-2

Purity: 97%

Molecular weight: 217.2680054

Ref: 10-F601792