CAS 280-13-7

8-oxa-3-azabicyclo[3.2.1]octane

Description:

8-Oxa-3-azabicyclo[3.2.1]octane, also known by its CAS number 280-13-7, is a bicyclic organic compound characterized by a unique structure that includes both oxygen and nitrogen atoms within its ring system. This compound features a bicyclic framework consisting of eight total carbon atoms, with one oxygen atom and one nitrogen atom incorporated into the structure. The presence of these heteroatoms contributes to its potential reactivity and interaction with biological systems. Typically, compounds of this nature may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The bicyclic structure can influence the compound's conformation and steric properties, which are crucial for its biological activity. Additionally, 8-oxa-3-azabicyclo[3.2.1]octane may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, due to the presence of the nitrogen atom, which can act as a nucleophile. Overall, this compound's unique structural features make it a subject of interest for further research in both synthetic and medicinal chemistry.

Formula: C₆H₁₁NO

InChI: InChI=1/C6H11NO/c1-2-6-4-7-3-5(1)8-6/h5-7H,1-4H2

SMILES: C1CC2CNCC1O2

8-Oxa-3-azabicyclo[3.2.1]octane

CAS: 280-13-7

Formula: C₆H₁₁NO

Purity: 98%

Color and Shape: Liquid

Molecular weight: 113.1576

Ref: IN-DA003NIX

8-Oxa-3-azabicyclo[3.2.1]octane

CAS: 280-13-7

Formula: C₆H₁₁NO

Purity: >95.0%(T)

Color and Shape: Colorless to Light yellow clear liquid

Molecular weight: 113.16

Ref: 3B-O0665

8-Oxa-3-aza-bicyclo[3.2.1]octane

CAS: 280-13-7

8-Oxa-3-aza-bicyclo[3.2.1]octane

Formula: C₆H₁₁NO

Purity: 98%

Color and Shape: Liquid

Molecular weight: 113.16g/mol

Ref: 54-OR923369

8-Oxa-3-azabicyclo[3.2.1]octane

CAS: 280-13-7

Formula: C₆H₁₁NO

Purity: 98%

Color and Shape: Liquid

Molecular weight: 113.16

Ref: 10-F221501