CAS 28004-60-6: 5-(1,3-benzodioxol-5-yl)-1,3,4-thiadiazol-2-amine

Description: 5-(1,3-benzodioxol-5-yl)-1,3,4-thiadiazol-2-amine is a chemical compound characterized by its unique structural features, which include a thiadiazole ring and a benzodioxole moiety. The thiadiazole ring contributes to its potential biological activity, often associated with antimicrobial and anti-inflammatory properties. The presence of the benzodioxole group may enhance its pharmacological profile, as this structure is known for its role in various bioactive compounds. This compound is typically synthesized through specific organic reactions involving thiadiazole derivatives and benzodioxole precursors. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its application in research and potential therapeutic uses. Additionally, the compound's reactivity may allow for further derivatization, making it a candidate for the development of novel pharmaceuticals. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₉H₇N₃O₂S

InChI: InChI=1/C9H7N3O2S/c10-9-12-11-8(15-9)5-1-2-6-7(3-5)14-4-13-6/h1-3H,4H2,(H2,10,12)

Synonyms:

• 1,3,4-Thiadiazol-2-amine, 5-(1,3-benzodioxol-5-yl)-
• 5-(1,3-Benzodioxol-5-yl)-1,3,4-thiadiazol-2-amine

5-(BENZO[D][1,3]DIOXOL-5-YL)-1,3,4-THIADIAZOL-2-AMINE

CAS: 28004-60-6

• Purity: 95.0%
• Molecular weight: 221.22999572753906

5-(benzo[d][1,3]dioxol-5-yl)-1,3,4-thiadiazol-2-amine

CAS: 28004-60-6

Versatile small molecule scaffold

• Formula: C₉H₇N₃O₂S
• Purity: Min. 95%
• Molecular weight: 221.23 g/mol