CymitQuimica logo

CAS 28010-12-0

:

2,4-Pentadienoicacid, 5-phenyl-, (2E,4E)-

Description:
2,4-Pentadienoic acid, 5-phenyl-, (2E,4E)-, also known by its CAS number 28010-12-0, is an organic compound characterized by its conjugated diene structure, which features two double bonds in a five-carbon chain. This compound typically exhibits a carboxylic acid functional group, contributing to its acidic properties. The presence of a phenyl group at the fifth carbon enhances its stability and influences its reactivity, making it a potential candidate for various chemical reactions, including polymerization and synthesis of more complex organic molecules. The (2E,4E) notation indicates the specific geometric configuration of the double bonds, which is crucial for determining the compound's physical and chemical properties, such as boiling point, solubility, and reactivity. Additionally, compounds with similar structures are often studied for their potential applications in materials science, pharmaceuticals, and as intermediates in organic synthesis. Overall, 2,4-Pentadienoic acid, 5-phenyl-, is a significant compound in organic chemistry with diverse implications in research and industry.
Formula:C11H10O2
InChI:InChI=1S/C11H10O2/c12-11(13)9-5-4-8-10-6-2-1-3-7-10/h1-9H,(H,12,13)/b8-4+,9-5+
InChI key:FEIQOMCWGDNMHM-KBXRYBNXSA-N
SMILES:C1=CC=C(C=C1)/C=C/C=C/C(=O)O
Synonyms:
  • 2,4-Pentadienoicacid, 5-phenyl-, (E,E)- (8CI)
  • (2E,4E)-5-Phenyl-2,4-pentadienoic acid
  • (2E,4E)-Cinnamylideneaceticacid
  • (E,E)-5-Phenyl-2,4-pentadienoic acid
  • 5-Phenyl-2E,4E-pentadienoic acid
  • 5-Phenyl-trans-2,trans-4-pentadienoic acid
  • Nsc 50789
  • a-trans-g-trans-b-Styrylacrylicacid
Found 6 products.