CAS 28010-12-0
:2,4-Pentadienoicacid, 5-phenyl-, (2E,4E)-
Description:
2,4-Pentadienoic acid, 5-phenyl-, (2E,4E)-, also known by its CAS number 28010-12-0, is an organic compound characterized by its conjugated diene structure, which features two double bonds in a five-carbon chain. This compound typically exhibits a carboxylic acid functional group, contributing to its acidic properties. The presence of a phenyl group at the fifth carbon enhances its stability and influences its reactivity, making it a potential candidate for various chemical reactions, including polymerization and synthesis of more complex organic molecules. The (2E,4E) notation indicates the specific geometric configuration of the double bonds, which is crucial for determining the compound's physical and chemical properties, such as boiling point, solubility, and reactivity. Additionally, compounds with similar structures are often studied for their potential applications in materials science, pharmaceuticals, and as intermediates in organic synthesis. Overall, 2,4-Pentadienoic acid, 5-phenyl-, is a significant compound in organic chemistry with diverse implications in research and industry.
Formula:C11H10O2
InChI:InChI=1S/C11H10O2/c12-11(13)9-5-4-8-10-6-2-1-3-7-10/h1-9H,(H,12,13)/b8-4+,9-5+
InChI key:FEIQOMCWGDNMHM-KBXRYBNXSA-N
SMILES:C1=CC=C(C=C1)/C=C/C=C/C(=O)O
Synonyms:- 2,4-Pentadienoicacid, 5-phenyl-, (E,E)- (8CI)
- (2E,4E)-5-Phenyl-2,4-pentadienoic acid
- (2E,4E)-Cinnamylideneaceticacid
- (E,E)-5-Phenyl-2,4-pentadienoic acid
- 5-Phenyl-2E,4E-pentadienoic acid
- 5-Phenyl-trans-2,trans-4-pentadienoic acid
- Nsc 50789
- a-trans-g-trans-b-Styrylacrylicacid
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
(2E,4E)-5-Phenyl-2,4-pentadienoic Acid
CAS:Formula:C11H10O2Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:174.20(2E,4E)-5-Phenylpenta-2,4-Dienoic Acid
CAS:(2E,4E)-5-Phenylpenta-2,4-Dienoic AcidFormula:C11H10O2Purity:>99%Molecular weight:174.2(2E,4E)-5-Phenyl-2,4-pentadienoic Acid
CAS:Formula:C11H10O2Purity:96%Color and Shape:SolidMolecular weight:174.1959(2E,4E)-5-Phenylpenta-2,4-dienoic acid
CAS:(2E,4E)-5-Phenylpenta-2,4-dienoic acidFormula:C11H10O2Purity:98%Molecular weight:174.2(2E,4E)-5-Phenyl-2,4-pentadienoic Acid
CAS:(2E,4E)-5-Phenyl-2,4-pentadienoic Acid is an anti-inflammatory compound that can be found in the natural compounds. It has a potent inhibitory effect on cancer cells and inflammatory diseases. (2E,4E)-5-Phenyl-2,4-pentadienoic Acid has been shown to inhibit tumor necrosis factor (TNF) alpha production in LPS-stimulated human monocytes. The structure of this molecule is similar to that of cinnamic acid derivatives which are known for their anti-inflammatory properties.Formula:C11H10O2Purity:Min. 95%Molecular weight:174.2 g/mol





