CymitQuimica logo

CAS 2802-62-2

:

4,6-Difluoropyrimidine

Description:
4,6-Difluoropyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring with two fluorine substituents at the 4 and 6 positions. Its molecular formula is C4H2F2N2, indicating the presence of four carbon atoms, two hydrogen atoms, two nitrogen atoms, and two fluorine atoms. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. 4,6-Difluoropyrimidine is known for its role as an intermediate in the synthesis of various pharmaceuticals and agrochemicals, particularly those targeting nucleic acid metabolism. The presence of fluorine atoms enhances its reactivity and stability, making it a valuable building block in medicinal chemistry. Additionally, it exhibits polar characteristics due to the electronegative fluorine atoms, which can influence its solubility and interaction with biological systems. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C4H2F2N2
InChI:InChI=1S/C4H2F2N2/c5-3-1-4(6)8-2-7-3/h1-2H
InChI key:InChIKey=MCLDVUCSDZGNRR-UHFFFAOYSA-N
SMILES:FC=1C=C(F)N=CN1
Synonyms:
  • Pyrimidine, 4,6-difluoro-
  • 4,6-Difluoropyrimidine
Found 4 products.