CAS 28020-37-3

2,6-dimethoxypyridin-3-amine

Description:

2,6-Dimethoxypyridin-3-amine is an organic compound characterized by its pyridine ring, which is substituted at the 2 and 6 positions with methoxy groups and at the 3 position with an amino group. This structure contributes to its unique chemical properties, including its potential as a building block in pharmaceuticals and agrochemicals. The presence of the amino group makes it a basic compound, capable of forming salts with acids. The methoxy groups enhance its solubility in organic solvents and may influence its reactivity and interaction with biological targets. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its molecular structure allows for various functionalization possibilities, making it a versatile intermediate in synthetic chemistry. Additionally, due to its nitrogen-containing heterocyclic nature, it may exhibit interesting biological activities, warranting further investigation in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₇H₁₀N₂O₂

InChI: InChI=1/C7H10N2O2/c1-10-6-4-3-5(8)7(9-6)11-2/h3-4H,8H2,1-2H3

SMILES: COc1ccc(c(n1)OC)N

Synonyms:

• 3-Amino-2,6-dimethoxypyridine

2,6-dimethoxypyridin-3-amine

CAS: 28020-37-3

Formula: C₇H₁₀N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 154.1665

Ref: IN-DA00BD4Z

3-Amino-2,6-dimethoxypyridine

CAS: 28020-37-3

3-Amino-2,6-dimethoxypyridine

Formula: C₇H₁₀N₂O₂

Purity: 95%

Color and Shape: very dark brown to black fused solid

Molecular weight: 154.17g/mol

Ref: 54-OR1585

3-Amino-2,6-dimethoxypyridine

CAS: 28020-37-3

Formula: C₇H₁₀N₂O₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 154.169

Ref: 10-F076143