CAS 28026-96-2
:3,5-Dihydroxy-4-methylbenzoic acid
Description:
3,5-Dihydroxy-4-methylbenzoic acid, with the CAS number 28026-96-2, is an aromatic compound characterized by the presence of two hydroxyl groups and a methyl group attached to a benzoic acid structure. This compound features a benzene ring substituted at the 3 and 5 positions with hydroxyl (-OH) groups and at the 4 position with a methyl (-CH3) group. It is typically a white to off-white crystalline solid, soluble in polar solvents such as water and alcohols due to the presence of hydroxyl groups, which can engage in hydrogen bonding. The compound exhibits acidic properties due to the carboxylic acid functional group, allowing it to donate protons in solution. Its structural features contribute to its potential applications in pharmaceuticals, biochemistry, and as a biochemical marker. Additionally, the presence of multiple hydroxyl groups may impart antioxidant properties, making it of interest in various research fields, including medicinal chemistry and materials science.
Formula:C8H8O4
InChI:InChI=1S/C8H8O4/c1-4-6(9)2-5(8(11)12)3-7(4)10/h2-3,9-10H,1H3,(H,11,12)
InChI key:InChIKey=KMRRXSZDSGYLCD-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(O)=C(C)C(O)=C1
Synonyms:- 2-Methyl-5-carboxyresorcinol
- 3,5-Dihydroxy-4-Methylbenzoate
- 3,5-Dihydroxy-p-toluic acid
- 4-Methyl-3,5-dihydroxybenzoic acid
- Benzoic acid, 3,5-dihydroxy-4-methyl-
- α-Resorcylic acid, 4-methyl-
- 3,5-Dihydroxy-4-methylbenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
3,5-Dihydroxy-4-methylbenzoic Acid
CAS:Formula:C8H8O4Purity:>98.0%(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:168.153,5-Dihydroxy-4-methylbenzoic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H7O4Purity:97%Color and Shape:powder, White to pale creamMolecular weight:167.143,5-Dihydroxy-4-methylbenzoic acid
CAS:Formula:C8H8O4Purity:98%Color and Shape:SolidMolecular weight:168.14673,5-Dihydroxy-4-methylbenzoic acid
CAS:3,5-Dihydroxy-4-methylbenzoic acid is a natural productFormula:C8H8O4Purity:99.64%Color and Shape:SolidMolecular weight:168.153,5-Dihydroxy-4-methylbenzoic acid
CAS:3,5-Dihydroxy-4-methylbenzoic acidPurity:>98.0%Molecular weight:168.15g/mol3,5-Dihydroxy-4-methylbenzoic acid
CAS:Formula:C8H8O4Purity:95%Color and Shape:Solid, CrystallineMolecular weight:168.1483,5-Dihydroxy-4-methylbenzoic acid
CAS:3,5-Dihydroxy-4-methylbenzoic acid is an efficient synthesis of the natural product lucidin. It is a quinone that is found in citrifolia and morindone, compounds which are used as analgesics and antipyretics. This compound has been shown to inhibit the growth of fungi by inhibition of protein synthesis. 3,5-Dihydroxy-4-methylbenzoic acid also inhibits the production of citric acid cycle intermediates such as succinic acid and fumaric acid.Formula:C8H8O4Purity:Min. 80%Color and Shape:PowderMolecular weight:168.15 g/mol







