CAS 28026-96-2: 3,5-Dihydroxy-4-methylbenzoic acid
Description:3,5-Dihydroxy-4-methylbenzoic acid, with the CAS number 28026-96-2, is an aromatic compound characterized by the presence of two hydroxyl groups and a methyl group attached to a benzoic acid structure. This compound features a benzene ring substituted at the 3 and 5 positions with hydroxyl (-OH) groups and at the 4 position with a methyl (-CH3) group. It is typically a white to off-white crystalline solid, soluble in polar solvents such as water and alcohols due to the presence of hydroxyl groups, which can engage in hydrogen bonding. The compound exhibits acidic properties due to the carboxylic acid functional group, allowing it to donate protons in solution. Its structural features contribute to its potential applications in pharmaceuticals, biochemistry, and as a biochemical marker. Additionally, the presence of multiple hydroxyl groups may impart antioxidant properties, making it of interest in various research fields, including medicinal chemistry and materials science.
Formula:C8H8O4
InChI:InChI=1S/C8H8O4/c1-4-6(9)2-5(8(11)12)3-7(4)10/h2-3,9-10H,1H3,(H,11,12)
InChI key:InChIKey=KMRRXSZDSGYLCD-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC(O)=C(C(O)=C1)C
- Synonyms:
- 2-Methyl-5-carboxyresorcinol
- 3,5-Dihydroxy-4-Methylbenzoate
- 3,5-Dihydroxy-p-toluic acid
- 4-Methyl-3,5-dihydroxybenzoic acid
- Benzoic acid, 3,5-dihydroxy-4-methyl-
- α-Resorcylic acid, 4-methyl-
- 3,5-Dihydroxy-4-methylbenzoic acid
