CAS 28027-18-1
:8-methoxy-4-oxo-1,4-dihydroquinoline-3-carboxylic acid
Description:
8-Methoxy-4-oxo-1,4-dihydroquinoline-3-carboxylic acid, with the CAS number 28027-18-1, is a chemical compound that belongs to the class of quinoline derivatives. This substance features a quinoline core structure, characterized by a bicyclic aromatic system that includes a nitrogen atom. The presence of a methoxy group (-OCH3) at the 8-position and a carboxylic acid group (-COOH) at the 3-position contributes to its unique chemical properties. The compound exhibits potential biological activity, which has been explored in various studies, particularly in the context of antimicrobial and anti-inflammatory effects. Its structural features may also allow for interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's solubility and reactivity can be influenced by the functional groups present, which may affect its application in pharmaceuticals or as a research tool. Overall, 8-methoxy-4-oxo-1,4-dihydroquinoline-3-carboxylic acid is a notable compound with potential utility in various chemical and biological contexts.
Formula:C11H9NO4
InChI:InChI=1/C11H9NO4/c1-16-8-4-2-3-6-9(8)12-5-7(10(6)13)11(14)15/h2-5H,1H3,(H,12,13)(H,14,15)
SMILES:COc1cccc2c1[nH]cc(c2=O)C(=O)O
Synonyms:- 3-Quinolinecarboxylic acid, 1,4-dihydro-8-methoxy-4-oxo-
- 3-Quinolinecarboxylic Acid, 4-Hydroxy-8-Methoxy-
- 4-Hydroxy-8-methoxyquinoline-3-carboxylic acid
- 4-Hydroxy-8-methoxyquinoline-3-caroboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Hydroxy-8-methoxy-3-quinolinecarboxylic acid
CAS:Formula:C11H9NO4Purity:95%Color and Shape:SolidMolecular weight:219.19354-Hydroxy-8-methoxyquinoline-3-carboxylic acid
CAS:<p>4-Hydroxy-8-methoxyquinoline-3-carboxylic acid</p>Purity:95%Color and Shape:SolidMolecular weight:219.19g/mol4-Hydroxy-8-methoxyquinoline-3-carboxylic acid
CAS:<p>4-Hydroxy-8-methoxyquinoline-3-carboxylic acid is an antibacterial agent that belongs to the group of diphenyl ethers. It is used in combination with a stabilizer, such as dodecyl sulfonate, to inhibit bacterial growth. 4-Hydroxy-8-methoxyquinoline-3-carboxylic acid inhibits bacterial growth by binding to the lipid II region of the bacterial cell membrane and forming a high affinity complex with dodecyl sulfonate. This results in inhibition of bacterial DNA synthesis and protein synthesis, leading to cell death. The compound has been shown to be effective against resistant bacteria such as Enterobacteriaceae and Pseudomonas aeruginosa. 4-Hydroxy-8-methoxyquinoline-3-carboxylic acid is soluble in water and methanol but not hydrochloric acid or sodium hydroxide solutions. It also has a</p>Formula:C11H9NO4Purity:Min. 95%Molecular weight:219.19 g/mol



