CAS 28033-08-1

ethyl 3-amino-6-bromo-pyridine-2-carboxylate

Description:

Ethyl 3-amino-6-bromo-pyridine-2-carboxylate is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of an amino group (-NH2) at the 3-position and a bromo substituent at the 6-position contributes to its reactivity and potential applications in medicinal chemistry. The ethyl ester functional group (-COOEt) at the 2-position enhances its solubility in organic solvents and may influence its biological activity. This compound is typically used as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. Its molecular structure allows for hydrogen bonding and potential interactions with biological targets, making it of interest in drug development. Additionally, the bromine atom can serve as a site for further chemical modifications, expanding its utility in synthetic chemistry. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental concerns.

Formula: C₈H₉BrN₂O₂

InChI: InChI=1/C8H9BrN2O2/c1-2-13-8(12)7-5(10)3-4-6(9)11-7/h3-4H,2,10H2,1H3

SMILES: CCOC(=O)c1c(ccc(Br)n1)N

Ethyl 3-amino-6-bromopicolinate

CAS: 28033-08-1

Formula: C₈H₉BrN₂O₂

Purity: 98%

Molecular weight: 245.076

Ref: 10-F244610

Ethyl 3-amino-6-bromopicolinate

CAS: 28033-08-1

Formula: C₈H₉BrN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 245.0733

Ref: IN-DA003IWX

Ethyl 3-amino-6-bromopicolinate

CAS: 28033-08-1

Ethyl 3-amino-6-bromopicolinate

Purity: 98%

Molecular weight: 245.076g/mol

Ref: 54-OR74494