CAS 28033-63-8

(2-methoxyphenyl)acetyl chloride

Description:

(2-Methoxyphenyl)acetyl chloride, with the CAS number 28033-63-8, is an organic compound characterized by its acetyl chloride functional group attached to a 2-methoxyphenyl moiety. This compound typically appears as a colorless to pale yellow liquid with a pungent odor, indicative of its reactivity. It is soluble in organic solvents such as dichloromethane and ether but is generally insoluble in water due to its hydrophobic aromatic structure. The presence of the acetyl chloride group makes it a reactive acyl chloride, capable of undergoing nucleophilic acyl substitution reactions, which makes it useful in organic synthesis, particularly in the formation of esters and amides. Additionally, the methoxy group enhances the electron density on the aromatic ring, influencing its reactivity and stability. Safety precautions are essential when handling this compound, as it can be corrosive and may cause irritation to the skin, eyes, and respiratory system. Proper storage in a cool, dry place, away from moisture and incompatible substances, is also crucial to maintain its integrity.

Formula: C₉H₉ClO₂

InChI: InChI=1/C9H9ClO2/c1-12-8-5-3-2-4-7(8)6-9(10)11/h2-5H,6H2,1H3

SMILES: COc1ccccc1CC(=O)Cl

Synonyms:

• Benzeneacetyl Chloride, 2-Methoxy-

2-(2-Methoxyphenyl)acetyl chloride

CAS: 28033-63-8

2-(2-Methoxyphenyl)acetyl chloride

Purity: 95%

Molecular weight: 184.62g/mol

Ref: 54-OR938487

2-(2-Methoxyphenyl)acetyl chloride

CAS: 28033-63-8

Formula: C₉H₉ClO₂

Purity: 95.0%

Molecular weight: 184.62

Ref: 10-F402754

2-(2-Methoxyphenyl)acetyl chloride

CAS: 28033-63-8

2-(2-Methoxyphenyl)acetyl chloride is an anti-tuberculosis drug that is selective for the Mycobacterium tuberculosis complex. It has been shown to be a potent inhibitor of dna synthesis in Mycobacterium tuberculosis and other mycobacteria, with an IC50 of 0.1 μM. 2-(2-Methoxyphenyl)acetyl chloride inhibits protein synthesis by inhibiting the activity of ribosomes, which are responsible for synthesizing proteins from mRNA. This drug also has a high selectivity against the Mycobacterium tuberculosis complex (MICs ≤0.1 μM). 2-(2-Methoxyphenyl)acetyl chloride can be synthesized using anthranilic acid, amines, and anilines as starting materials. The two isomers that are formed can be differentiated by their conformational properties and phosphorus oxychloride reactivity.

Formula: C₉H₉ClO₂

Purity: Min. 95%

Molecular weight: 184.62 g/mol

Ref: 3D-DBA03363