CAS 28036-33-1
:imidazo[1,2-a]pyridin-3-amine
Description:
Imidazo[1,2-a]pyridin-3-amine is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. This compound typically exhibits a planar structure due to the aromatic nature of the rings, allowing for potential interactions with biological targets. It contains an amino group at the 3-position of the pyridine ring, which can participate in hydrogen bonding and enhance its reactivity. Imidazo[1,2-a]pyridin-3-amine is often studied for its pharmacological potential, particularly in medicinal chemistry, as it may exhibit various biological activities, including antimicrobial and anticancer properties. The compound's solubility and stability can vary depending on the solvent and environmental conditions, making it important to consider these factors in experimental applications. Additionally, its molecular structure allows for potential modifications, which can lead to the development of derivatives with improved efficacy or selectivity in therapeutic contexts. Overall, imidazo[1,2-a]pyridin-3-amine represents a significant scaffold in drug discovery and development.
Formula:C7H7N3
InChI:InChI=1/C7H7N3/c8-6-5-9-7-3-1-2-4-10(6)7/h1-5H,8H2
SMILES:c1ccn2c(cnc2c1)N
Synonyms:- Imidazo[1,2-a]pyridin-3-amin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Aminoimidazo[1,2-a]pyridine, 97%
CAS:It is an intermediate in the production of mutagenic pyrolyzates. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU referenFormula:C7H7N3Purity:97%Molecular weight:133.153-Aminoimidazo(1,2-a)Pyridine
CAS:Formula:C7H7N3Purity:97%Color and Shape:SolidMolecular weight:133.1506Imidazo[1,2-a]pyridin-3-amine
CAS:Imidazo[1,2-a]pyridin-3-aminePurity:97%Molecular weight:133.15g/molImidazo[1,2-a]pyridin-3-amine
CAS:Formula:C7H7N3Purity:97%Color and Shape:No data available.Molecular weight:133.1543-Amino-imidazo[1,2-a]pyridine
CAS:Controlled ProductApplications Intermediate in the production of mutagenic pyrolyzates.
References Grassy, G., et al.: Eur. J. Med. Chem., 17, 109 (1982),Formula:C7H7N3Color and Shape:NeatMolecular weight:133.15





