CAS 2804-16-2
:10-[3-(piperazin-1-yl)propyl]-2-(trifluoromethyl)-10H-phenothiazine
Description:
10-[3-(Piperazin-1-yl)propyl]-2-(trifluoromethyl)-10H-phenothiazine, with CAS number 2804-16-2, is a chemical compound belonging to the phenothiazine class, which is characterized by a tricyclic structure containing sulfur and nitrogen atoms. This compound features a trifluoromethyl group, which enhances its lipophilicity and may influence its biological activity. The presence of a piperazine moiety suggests potential interactions with neurotransmitter receptors, making it of interest in pharmacological research, particularly in the context of antipsychotic or anxiolytic properties. The trifluoromethyl group can also affect the compound's stability and reactivity. In terms of physical properties, phenothiazines typically exhibit moderate solubility in organic solvents and limited solubility in water. The compound's structure may confer specific pharmacokinetic properties, influencing its absorption, distribution, metabolism, and excretion (ADME) profile. Overall, this compound's unique structural features make it a subject of interest in medicinal chemistry and drug development.
Formula:C20H22F3N3S
InChI:InChI=1/C20H22F3N3S/c21-20(22,23)15-6-7-19-17(14-15)26(16-4-1-2-5-18(16)27-19)11-3-10-25-12-8-24-9-13-25/h1-2,4-7,14,24H,3,8-13H2
SMILES:c1ccc2c(c1)N(CCCN1CCNCC1)c1cc(ccc1S2)C(F)(F)F
Synonyms:- 10-(3-(1-Piperazinyl)propyl)-2-(trifluoromethyl)-10H-phenothiazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
