CAS 28056-54-4
:2,2,4-Trimethylcyclopentanone
Description:
2,2,4-Trimethylcyclopentanone is a cyclic ketone characterized by its unique structure, which includes a cyclopentane ring with three methyl groups attached at the 2 and 4 positions. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It has a relatively low boiling point and moderate solubility in organic solvents, making it useful in various chemical applications. The presence of the ketone functional group contributes to its reactivity, allowing it to participate in various organic reactions, such as nucleophilic additions. Additionally, 2,2,4-trimethylcyclopentanone is often utilized as a solvent, flavoring agent, or intermediate in the synthesis of other organic compounds. Its physical and chemical properties, including density and viscosity, are influenced by the steric effects of the methyl groups, which can also affect its volatility and stability. Safety data indicates that, like many organic solvents, it should be handled with care to avoid inhalation or skin contact.
Formula:C8H14O
InChI:InChI=1S/C8H14O/c1-6-4-7(9)8(2,3)5-6/h6H,4-5H2,1-3H3
InChI key:InChIKey=PJXIBUIXCXSNCM-UHFFFAOYSA-N
SMILES:CC1(C)C(=O)CC(C)C1
Synonyms:- 2,2,4-Trimethylcyclopentan-1-one
- 2,2,4-Trimethylcyclopentanone
- Cyclopentanone, 2,2,4-trimethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,2,4-Trimethylcyclopentanone
CAS:Formula:C8H14OPurity:>98.0%(GC)Color and Shape:Colorless to Light yellow to Light orange clear liquidMolecular weight:126.202,2,4-Trimethylcyclopentanone
CAS:2,2,4-TrimethylcyclopentanonePurity:95%Molecular weight:126.20g/mol2,2,4-Trimethylcyclopentanone
CAS:<p>2,2,4-Trimethylcyclopentanone is a cyclic ketone with the molecular formula CH(CH)3CO. It has a tautomeric equilibrium with 2,2-dimethylcyclohexanone. The compound is prepared by the addition of acetyl chloride to an aldehyde in the presence of base. The compound exhibits UV absorption at 270 nm and an uv spectrum indicative of a cyclic ketone. The compound can be synthesized from 2-methylcyclohexanol and formaldehyde in the presence of potassium hydroxide or sodium hydroxide. 2,2,4-Trimethylcyclopentanone has been used as a synthetic intermediate for other cyclic ketones as well as for pharmaceuticals, flavoring agents, and fragrances.</p>Formula:C8H14OPurity:Min. 95%Color and Shape:Colorless Clear LiquidMolecular weight:126.2 g/mol



