CAS 280566-45-2
:2-chloro-6-trifluoromethyl nicotinic acid
Description:
2-Chloro-6-trifluoromethyl nicotinic acid is a chemical compound that belongs to the class of pyridine derivatives, specifically a substituted nicotinic acid. It features a chlorine atom and a trifluoromethyl group attached to the aromatic ring of the nicotinic acid structure, which significantly influences its chemical properties and reactivity. This compound is typically characterized by its solid state at room temperature and exhibits moderate solubility in polar solvents due to the presence of the carboxylic acid functional group. The trifluoromethyl group enhances its lipophilicity and can affect its biological activity, making it of interest in pharmaceutical research. Additionally, the chlorine substituent can impart unique electronic properties, potentially influencing the compound's interaction with biological targets. Overall, 2-chloro-6-trifluoromethyl nicotinic acid is notable for its potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental impact.
Formula:C15H10ClFO
InChI:InChI=1/C15H10ClFO/c16-14-4-2-1-3-11(14)7-10-15(18)12-5-8-13(17)9-6-12/h1-10H/b10-7+
Synonyms:- Rarechem Al Bo 2184
- 4-[(4,6-Dimethylpyrimidin-2-Yl)Thio]Aniline
- 2-[(4-Aminophenyl)Thio]-4,6-Dimethylpyrimidine
- 2-Chloro-6-Trifluoromethyl-3-Pyridinecarboxylic Acid
- 2-Chloro-6-Trifluoromethylnicotinic
- 4-[(4,6-Dimethylpyrimidin-2-Yl)Sulfanyl]Aniline
- 2-Chloro-6-(Trifluoromethyl)Pyridine-3-Carboxylic Acid
- (2E)-3-(2-chlorophenyl)-1-(4-fluorophenyl)prop-2-en-1-one
- 2-Chloro-6-(Trifluoromethyl)Nicotic Acid
- 2-Chloro-6-trifluoromethylnicotinic acid
- 2-Chloro-6-(trifluoromethyl)nicotinic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Chloro-6-trifluoromethylnicotinic acid
CAS:Formula:C7H3ClF3NO2Purity:98%Color and Shape:SolidMolecular weight:225.55242-Chloro-6-(trifluoromethyl)nicotinic acid
CAS:<p>2-Chloro-6-(trifluoromethyl)nicotinic acid</p>Formula:C7H3ClF3NO2Purity:≥95%Color and Shape: fine. white crystalsMolecular weight:225.55g/mol2-Chloro-6-(trifluoromethyl)nicotinic Acid
CAS:Formula:C7H3ClF3NO2Purity:>98.0%(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:225.552-Chloro-6-trifluoromethylnicotinic acid
CAS:Formula:C7H3ClF3NO2Purity:98%Color and Shape:SolidMolecular weight:225.55



