CAS 280582-25-4

2,4-dichloro-5-ethoxypyrimidine

Description:

2,4-Dichloro-5-ethoxypyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with two chlorine atoms at the 2 and 4 positions and an ethoxy group at the 5 position. This compound typically appears as a solid and is soluble in organic solvents, reflecting its non-polar characteristics due to the presence of the ethoxy group. The dichloro substitutions enhance its reactivity, making it useful in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. The presence of the ethoxy group can influence its biological activity and solubility properties. Additionally, 2,4-dichloro-5-ethoxypyrimidine may exhibit specific interactions with biological targets, which can be explored in medicinal chemistry. Safety data sheets should be consulted for handling and storage guidelines, as halogenated compounds can pose environmental and health risks. Overall, this compound is of interest in both synthetic organic chemistry and potential applications in drug development.

Formula: C₆H₆Cl₂N₂O

InChI: InChI=1S/C6H6Cl2N2O/c1-2-11-4-3-9-6(8)10-5(4)7/h3H,2H2,1H3

InChI key: InChIKey=LDWUISBWFCSUNG-UHFFFAOYSA-N

SMILES: O(CC)C=1C(Cl)=NC(Cl)=NC1

Synonyms:

• Pyrimidine, 2,4-dichloro-5-ethoxy-

2,4-dichloro-5-ethoxypyrimidine

CAS: 280582-25-4

Formula: C₆H₆Cl₂N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 193.0306

Ref: IN-DA00BG5G

2,4-Dichloro-5-ethoxypyrimidine

CAS: 280582-25-4

2,4-Dichloro-5-ethoxypyrimidine

Purity: 95%

Molecular weight: 193.03g/mol

Ref: 54-OR525616

2,4-Dichloro-5-ethoxypyrimidine

CAS: 280582-25-4

2,4-Dichloro-5-ethoxypyrimidine is a chemical compound that is used as a reagent and a reaction component in organic synthesis. It is an intermediate for the production of other chemicals. The high purity of this compound makes it suitable for research purposes. It can be used as a versatile building block or as an intermediate to build complex compounds. 2,4-Dichloro-5-ethoxypyrimidine has CAS No. 280582-25-4. This chemical is also known by the name Et2N2Cl5O2P.

Formula: C₆H₆Cl₂N₂O

Purity: Min. 95%

Color and Shape: Solid

Molecular weight: 193.03 g/mol

Ref: 3D-FD143382

2,4-Dichloro-5-ethoxypyrimidine

CAS: 280582-25-4

Formula: C₆H₆Cl₂N₂O

Purity: 97%

Color and Shape: Liquid

Molecular weight: 193.03

Ref: 10-F320520