CAS 2806-97-5
:2-Butynal diethyl acetal
Description:
2-Butynal diethyl acetal, with the CAS number 2806-97-5, is an organic compound characterized by its acetal functional group derived from 2-butyne. It typically appears as a colorless to pale yellow liquid with a distinctive odor. This compound is known for its stability under normal conditions, making it useful in various chemical reactions, particularly in organic synthesis. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic nature. The presence of the acetal group allows it to participate in reactions typical of acetals, such as hydrolysis under acidic conditions. Additionally, 2-butyne's structure contributes to its reactivity, enabling it to undergo transformations like oxidation or reduction. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested. Overall, 2-butyne diethyl acetal serves as a valuable intermediate in the synthesis of various organic compounds in the field of chemistry.
Formula:C8H14O2
InChI:InChI=1/C8H14O2/c1-4-7-8(9-5-2)10-6-3/h8H,5-6H2,1-3H3
SMILES:CC#CC(OCC)OCC
Synonyms:- 1,1-Diethoxybut-2-yne
- 2-Butyne, 1,1-Diethoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Butynal diethyl acetal, 98%
CAS:2-Butynal diethyl acetal is used as pharmaceutical intermediates. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU referenFormula:CH3CCCH(OCH2CH3)2Purity:98%Color and Shape:Clear colorless to yellow, LiquidMolecular weight:142.2



