CAS 280744-09-4: 3-(2,4-Dichlorophenyl)-4-(1-methyl-1H-indol-3-yl)-1H-pyrrole-2,5-dione
Description:3-(2,4-Dichlorophenyl)-4-(1-methyl-1H-indol-3-yl)-1H-pyrrole-2,5-dione, with the CAS number 280744-09-4, is a synthetic organic compound characterized by its complex molecular structure, which includes a pyrrole ring and multiple aromatic substituents. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity due to its ability to interact with various biological targets. The presence of the dichlorophenyl group may enhance its lipophilicity and influence its pharmacokinetic properties. Additionally, the indole moiety is known for its role in various biological processes, potentially contributing to the compound's activity. The compound may also display unique optical properties due to its conjugated system, which can affect its reactivity and stability. Overall, this substance is of interest in medicinal chemistry and may be explored for its potential therapeutic applications, particularly in the development of novel pharmaceuticals. However, specific characteristics such as solubility, melting point, and reactivity would require empirical data for precise evaluation.
Formula:C19H12Cl2N2O2
InChI:InChI=1S/C19H12Cl2N2O2/c1-23-9-13(11-4-2-3-5-15(11)23)17-16(18(24)22-19(17)25)12-7-6-10(20)8-14(12)21/h2-9H,1H3,(H,22,24,25)
InChI key:InChIKey=JCSGFHVFHSKIJH-UHFFFAOYSA-N
SMILES:O=C1NC(=O)C(C2=CN(C=3C=CC=CC23)C)=C1C=4C=CC(Cl)=CC4Cl
- Synonyms:
- 1H-Pyrrole-2,5-dione, 3-(2,4-dichlorophenyl)-4-(1-methyl-1H-indol-3-yl)-
- Sb 216763
- Sb216763
- 3-(2,4-Dichlorophenyl)-4-(1-methyl-1H-indol-3-yl)-1H-pyrrole-2,5-dione
