CAS 280774-03-0

[1-(1-methylethyl)piperidin-4-yl]methanol

Description:

[1-(1-methylethyl)piperidin-4-yl]methanol, with the CAS number 280774-03-0, is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a branched alkyl group, specifically isopropyl, attached to the piperidine nitrogen, contributing to its steric properties. The presence of a hydroxymethyl group (-CH2OH) at the 4-position of the piperidine ring enhances its potential for hydrogen bonding, influencing its solubility and reactivity. Generally, compounds of this type may exhibit biological activity, making them of interest in medicinal chemistry. The molecular structure suggests that it may interact with various biological targets, potentially affecting neurotransmitter systems. Its physical properties, such as boiling point, melting point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Overall, [1-(1-methylethyl)piperidin-4-yl]methanol represents a class of compounds that can be explored for various applications, particularly in pharmacology and organic synthesis.

Formula: C₉H₁₉NO

InChI: InChI=1/C9H19NO/c1-8(2)10-5-3-9(7-11)4-6-10/h8-9,11H,3-7H2,1-2H3

SMILES: CC(C)N1CCC(CC1)CO

Synonyms:

• [1-(Propan-2-Yl)Piperidin-4-Yl]Methanol
• 4-Piperidinemethanol, 1-(1-Methylethyl)-

4-Piperidinemethanol,1-(1-methylethyl)-(9CI)

CAS: 280774-03-0

Formula: C₉H₁₉NO

Purity: 95%

Color and Shape: Solid

Molecular weight: 157.2533

Ref: IN-DA00C1TT

(1-Isopropylpiperidin-4-yl)methanol

CAS: 280774-03-0

(1-Isopropylpiperidin-4-yl)methanol

Purity: 95%

Molecular weight: 157.25g/mol

Ref: 54-OR76395

(1-isopropylpiperidin-4-yl)methanol

CAS: 280774-03-0

Formula: C₉H₁₉NO

Purity: 95%

Color and Shape: Solid

Molecular weight: 157.257

Ref: 10-F308904

(1-Isopropyl-4-piperidinyl)methanol

Controlled Product

CAS: 280774-03-0

Formula: C₉H₁₉NO

Color and Shape: Neat

Molecular weight: 157.253

Ref: TR-I822216