CAS 28092-62-8
:(3aS,6aR)-1,3-Dibenzyldihydro-1H-furo[3,4-d]imidazole-2,4-dione
Description:
(3aS,6aR)-1,3-Dibenzyldihydro-1H-furo[3,4-d]imidazole-2,4-dione, with CAS number 28092-62-8, is a chemical compound characterized by its complex bicyclic structure that incorporates both furan and imidazole moieties. This compound features two benzyl groups attached to a dihydrofuro-imidazole framework, contributing to its unique physical and chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the imidazole ring suggests potential biological activity, as imidazole derivatives are often found in pharmaceuticals and biologically active compounds. The stereochemistry indicated by the (3aS,6aR) configuration suggests specific spatial arrangements that can influence the compound's reactivity and interactions with biological targets. Additionally, the diketone functional groups (2,4-dione) may participate in various chemical reactions, including tautomerization and condensation, making this compound of interest in synthetic organic chemistry and medicinal chemistry research.
Formula:C19H18N2O3
InChI:InChI=1S/C19H18N2O3/c22-18-17-16(13-24-18)20(11-14-7-3-1-4-8-14)19(23)21(17)12-15-9-5-2-6-10-15/h1-10,16-17H,11-13H2/t16-,17-/m0/s1
InChI key:InChIKey=FGFSEMWCZBVRHG-IRXDYDNUSA-N
SMILES:C(N1[C@]2([C@@](N(CC3=CC=CC=C3)C1=O)(COC2=O)[H])[H])C4=CC=CC=C4
Synonyms:- (3aS,6aR)-Tetrahydro-1,3-bis(phenylmethyl)-1H-furo[3,4-d]imidazole-2,4-dione
- 1H-Furo[3,4-d]imidazole-2,4-dione, 1,3-dibenzyltetrahydro-, (3aS,6aR)-
- (3AS,6aR)-1,3-dibenzyltetrahydro-1H-furo(3,4-d)imidazole-2,4-dione
- 1H-Furo[3,4-d]imidazole-2,4-dione, tetrahydro-1,3-bis(phenylmethyl)-, (3aS,6aR)-
- 1H-Furo[3,4-d]imidazole-2,4-dione, tetrahydro-1,3-bis(phenylmethyl)-, (3aS-cis)-
- (3aS,6aR)-1,3-Dibenzyldihydro-1H-furo[3,4-d]imidazole-2,4-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

