CAS 28095-18-3

6-[(2R)-2,3-dihydroxy-3-methylbutyl]-7-methoxy-2H-chromen-2-one

Description:

The chemical substance known as "6-[(2R)-2,3-dihydroxy-3-methylbutyl]-7-methoxy-2H-chromen-2-one," with the CAS number 28095-18-3, is a flavonoid derivative characterized by its chromone backbone. This compound features a methoxy group at the 7-position and a side chain at the 6-position that includes a 2,3-dihydroxy-3-methylbutyl group, which contributes to its biological activity. Flavonoids, including this compound, are known for their antioxidant properties, which can help mitigate oxidative stress in biological systems. The presence of hydroxyl groups enhances its potential for hydrogen bonding and solubility in polar solvents. Additionally, the stereochemistry indicated by the (2R) configuration suggests specific spatial arrangements that may influence its interaction with biological targets. This compound may exhibit various pharmacological effects, including anti-inflammatory and antimicrobial activities, making it of interest in medicinal chemistry and natural product research. Its structural features and potential bioactivities warrant further investigation for applications in health and disease management.

Formula: C₁₅H₁₈O₅

InChI: InChI=1/C15H18O5/c1-15(2,18)13(16)7-10-6-9-4-5-14(17)20-12(9)8-11(10)19-3/h4-6,8,13,16,18H,7H2,1-3H3/t13-/m1/s1

SMILES: CC(C)([C@@H](Cc1cc2ccc(=O)oc2cc1OC)O)O

Synonyms:

• Ulopterol

Ulopterol

CAS: 28095-18-3

Formula: C₁₅H₁₈O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 278.3004

Ref: IN-DA00C1IU

Ulopterol

CAS: 28095-18-3

Formula: C₁₅H₁₈O₅

Purity: 95%~99%

Molecular weight: 278.304

Ref: BP-BP4737

Peucedanol methyl ether

CAS: 28095-18-3

Peucedanol methyl ether is a bioactive natural compound, which is derived from certain species of the Peucedanum genus, commonly found in various geographic regions. This compound is predominantly obtained from natural extracts through advanced chromatographic techniques. Its molecular structure is characterized by its functional groups, which contribute to its biological activities.

Formula: C₁₅H₁₈O₅

Purity: Min. 95%

Ref: 3D-FP73803