CAS 28096-37-9

Benzenemethanamine, 5-chloro-2-methyl-, hydrochloride (1:1)

Description:

Benzenemethanamine, 5-chloro-2-methyl-, hydrochloride (1:1), commonly referred to as a hydrochloride salt, is a chemical compound characterized by its amine functional group and aromatic structure. The presence of a chlorine atom at the 5-position and a methyl group at the 2-position on the benzene ring contributes to its unique reactivity and properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, particularly in pharmaceuticals. The compound may exhibit biological activity, making it of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, and it may be involved in various synthetic pathways. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken. Overall, this compound exemplifies the diverse chemistry associated with substituted amines and their derivatives.

Formula: C₈H₁₀ClN·ClH

InChI: InChI=1S/C8H10ClN.ClH/c1-6-2-3-8(9)4-7(6)5-10;/h2-4H,5,10H2,1H3;1H

InChI key: InChIKey=ISUVLFMHANADML-UHFFFAOYSA-N

SMILES: C(N)C1=C(C)C=CC(Cl)=C1.Cl

Synonyms:

• Benzylamine, 5-chloro-2-methyl-, hydrochloride
• (5-Chloro-2-methylphenyl)methanamine hydrochloride
• Benzenemethanamine, 5-chloro-2-methyl-, hydrochloride (1:1)

5-Chloro-2-methylbenzylamine hydrochloride

CAS: 28096-37-9

5-Chloro-2-methylbenzylamine hydrochloride is a chemical reagent used in the production of pharmaceuticals and other chemicals. It is also known as 5-Chloro-2-methylbenzaldehyde, or 5-Methoxyindole. 5-Chloro-2-methylbenzylamine hydrochloride is an important building block for the synthesis of many complex compounds with high purity and quality. This compound is also versatile and can be used as a reaction component or as a reagent. CAS No: 28096-37-9.

Formula: C₈H₁₀ClN·HCl

Purity: Min. 95%

Molecular weight: 192.09 g/mol

Ref: 3D-FC66271