CAS 28096-56-2
:4-(Dimethylamino)-3-nitrobenzoic acid
Description:
4-(Dimethylamino)-3-nitrobenzoic acid, with the CAS number 28096-56-2, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with a dimethylamino group and a nitro group. This compound typically appears as a solid and is known for its yellow to orange color, which is attributed to the presence of the nitro group. It is soluble in polar solvents such as water and alcohols, while its solubility in non-polar solvents is limited. The presence of the dimethylamino group imparts basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the nitro group contributes to the compound's reactivity and potential applications in dye synthesis and as a pH indicator. Safety considerations should be taken into account, as nitro compounds can be hazardous, and appropriate handling and disposal methods should be followed. Overall, 4-(Dimethylamino)-3-nitrobenzoic acid is a versatile compound with significant implications in organic chemistry and materials science.
Formula:C9H10N2O4
InChI:InChI=1S/C9H10N2O4/c1-10(2)7-4-3-6(9(12)13)5-8(7)11(14)15/h3-5H,1-2H3,(H,12,13)
InChI key:InChIKey=ZXBMWJZLUDXEPS-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(N(C)C)C=CC(C(O)=O)=C1
Synonyms:- Benzoic Acid, 4-(Dimethylamino)-3-Nitro-
- 4-(Dimethylamino)-3-Nitrobenzoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-(Dimethylamino)-3-nitrobenzoic acid
CAS:<p>4-(Dimethylamino)-3-nitrobenzoic acid is a chemical compound with CAS No. 28096-56-2. It is a high quality chemical reagent, useful as an intermediate for the synthesis of complex compounds and fine chemicals. It is also a useful building block for the synthesis of versatile building blocks, and can be used in reactions to form new chemical compounds. 4-(Dimethylamino)-3-nitrobenzoic acid is also a versatile building block that can be used in many reactions to form new chemical compounds, and can be used as a research chemical or speciality chemical.</p>Formula:C9H10N2O4Purity:Min. 95%Molecular weight:210.19 g/mol4-(Dimethylamino)-3-nitrobenzoic Acid
CAS:Controlled Product<p>Applications 4-(dimethylamino)-3-nitrobenzoic Acid (cas# 28096-56-2) is a useful research chemical.<br></p>Formula:C9H10N2O4Color and Shape:NeatMolecular weight:210.187

