CAS 28110-70-5: Chromium (III) tetraphenylporphine chloride
Description:Chromium (III) tetraphenylporphine chloride is a coordination compound featuring a chromium ion coordinated to a tetraphenylporphyrin ligand, which is a macrocyclic structure known for its ability to stabilize metal ions. This compound typically exhibits a deep color, often purple or violet, due to the electronic transitions within the porphyrin ring. The presence of the chloride ion indicates that it is a salt, which can influence its solubility and reactivity. Chromium (III) in this context is in a +3 oxidation state, which is common for porphyrin complexes and contributes to the stability and electronic properties of the compound. The tetraphenylporphyrin ligand provides a planar structure that allows for effective π-π stacking interactions and can facilitate electron transfer processes. This compound is of interest in various fields, including catalysis, photochemistry, and as a potential model for biological systems involving heme-like structures. Its unique properties make it a valuable subject of study in coordination chemistry and materials science.
Formula:C44H28ClCrN4
InChI:InChI=1/C44H28N4.ClH.Cr/c1-5-13-29(14-6-1)41-33-21-23-35(45-33)42(30-15-7-2-8-16-30)37-25-27-39(47-37)44(32-19-11-4-12-20-32)40-28-26-38(48-40)43(31-17-9-3-10-18-31)36-24-22-34(41)46-36;;/h1-28H;1H;/q-2;;+3/p-1/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40u;;
- Synonyms:
- Chromiumtetraphenylporphinechloride
- Chromium(III) tetraphenylporphine chloride
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Chromium(III) tetraphenylporphine chloride REF: 08-24-0800CAS: 28110-70-5 | - - - | 269.00 €~770.00 € | Fri 11 Apr 25 |
![]() | Cr(III) meso-Tetraphenylporphine Chloride (contains 1-3% chlorin) REF: FT-T41015CAS: 28110-70-5 | >95% | To inquire | Mon 21 Apr 25 |

Chromium(III) tetraphenylporphine chloride
Ref: 08-24-0800
1g | 770.00 € | ||
250mg | 269.00 € |

Cr(III) meso-Tetraphenylporphine Chloride (contains 1-3% chlorin)
Ref: FT-T41015
1g | To inquire | ||
250mg | To inquire |