CAS 28115-68-6

(-)-Pluviatolide

Description:

(-)-Pluviatolide is a naturally occurring chemical compound classified as a sesquiterpene lactone. It is primarily derived from various plant sources, particularly those in the Asteraceae family. This compound is characterized by its complex bicyclic structure, which contributes to its unique chemical properties and biological activities. (-)-Pluviatolide exhibits notable anti-inflammatory and cytotoxic effects, making it of interest in pharmacological research. Its molecular formula reflects a specific arrangement of carbon, hydrogen, and oxygen atoms, which is typical for sesquiterpenes. The compound's stereochemistry is significant, as the (-) designation indicates its specific optical activity, which can influence its interaction with biological systems. Additionally, (-)-Pluviatolide has been studied for its potential applications in traditional medicine and as a lead compound for drug development. Its relatively low toxicity and ability to modulate various biological pathways further enhance its appeal in the field of natural product chemistry and medicinal research.

Formula: C₂₀H₂₀O₆

InChI: InChI=1S/C20H20O6/c1-23-18-8-13(2-4-16(18)21)7-15-14(10-24-20(15)22)6-12-3-5-17-19(9-12)26-11-25-17/h2-5,8-9,14-15,21H,6-7,10-11H2,1H3/t14-,15+/m0/s1

InChI key: InChIKey=OCTZTNYFALPGHW-LSDHHAIUSA-N

SMILES: C([C@@H]1[C@@H](CC=2C=C3C(=CC2)OCO3)COC1=O)C4=CC(OC)=C(O)C=C4

Synonyms:

• 2(3H)-Furanone, dihydro-4-piperonyl-3-vanillyl-
• 2(3H)-Furanone, 4-(1,3-benzodioxol-5-ylmethyl)dihydro-3-[(4-hydroxy-3-methoxyphenyl)methyl]-, (3R-trans)-
• Pluviatolide
• (3R,4R)-4-(1,3-Benzodioxol-5-ylmethyl)dihydro-3-[(4-hydroxy-3-methoxyphenyl)methyl]-2(3H)-furanone
• 2(3H)-Furanone, 4-(1,3-benzodioxol-5-ylmethyl)dihydro-3-[(4-hydroxy-3-methoxyphenyl)methyl]-, (3R,4R)-

Pluviatolide

CAS: 28115-68-6

(-)-Pluviatolide can inhibit electrically-induced and acetylcholine-induced contraction in the isolated guinea-pig ileum.

Formula: C₂₀H₂₀O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 356.37

Ref: TM-TN4812

Pluviatolide

CAS: 28115-68-6

Pluviatolide is a sesquiterpene lactone, which is a secondary metabolite derived from plants. Specifically, it is sourced from various species within the Asteraceae family. The mode of action of Pluviatolide involves the induction of apoptosis, a programmed cell death pathway. It achieves this by modulating key signaling pathways that regulate cell survival and apoptosis, including the NF-κB and MAPK pathways. This modulation leads to the activation of caspases and subsequent cell death in cancerous cells.

Formula: C₂₀H₂₀O₆

Purity: Min. 95%

Molecular weight: 356.4 g/mol

Ref: 3D-DBA11568