CymitQuimica logo

CAS 2812-47-7

:

2-Pyrrolidinecarboxamide

Description:
2-Pyrrolidinecarboxamide, also known as N-(2-pyrrolidinyl)formamide, is an organic compound characterized by its pyrrolidine ring structure, which is a five-membered cyclic amine. This substance features a carboxamide functional group, contributing to its polar nature and potential solubility in polar solvents. It typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. The compound is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological systems. Its molecular structure allows for hydrogen bonding, which can influence its reactivity and interaction with other molecules. Additionally, 2-Pyrrolidinecarboxamide may exhibit properties such as moderate stability under standard conditions, but it should be handled with care due to potential reactivity with strong acids or bases. As with many amides, it may also participate in various chemical reactions, including hydrolysis and amidation, making it a versatile compound in organic synthesis.
Formula:C5H10N2O
InChI:InChI=1S/C5H10N2O/c6-5(8)4-2-1-3-7-4/h4,7H,1-3H2,(H2,6,8)
InChI key:VLJNHYLEOZPXFW-UHFFFAOYSA-N
SMILES:C1CC(NC1)C(=O)N
Synonyms:
  • Prolinamide(7CI,8CI)
  • (?à)-2-Pyrrolidinecarboxamide
  • DL-Proline amide
  • Pyrrolidine-2-carboxylic acid amide
Found 6 products.