CAS 28120-16-3

2-(Aminooxy)-3-methylbutanoic acid

Description:

2-(Aminooxy)-3-methylbutanoic acid, also known by its CAS number 28120-16-3, is an organic compound characterized by the presence of both an aminooxy functional group and a carboxylic acid group. This compound features a branched aliphatic structure, with a methyl group attached to the second carbon of a four-carbon backbone. The aminooxy group (-NH2O) is known for its ability to form covalent bonds with carbonyl compounds, making it useful in various biochemical applications, particularly in the context of modifying proteins and other biomolecules. The presence of the carboxylic acid group contributes to its acidic properties, allowing it to participate in acid-base reactions. Additionally, this compound is soluble in water due to its polar functional groups, which enhances its reactivity in biological systems. Overall, 2-(Aminooxy)-3-methylbutanoic acid is a versatile compound with potential applications in medicinal chemistry and bioconjugation strategies.

Formula: C₅H₁₁NO₃

InChI: InChI=1S/C5H11NO3/c1-3(2)4(9-6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)

InChI key: InChIKey=YOZLTTADSLAKPE-UHFFFAOYSA-N

SMILES: C(C(C)C)(C(O)=O)ON

Synonyms:

• 2-(Aminooxy)-3-methylbutanoic acid
• 2-Aminooxy-3-methyl-butyric acid
• Butanoic acid, 2-(aminooxy)-3-methyl-
• α-Aminoxyisovalerianic acid
• Butyric acid, 2-(aminooxy)-3-methyl-