CymitQuimica logo

CAS 281208-98-8

:

2-chloro-6-ethoxyquinoline-3-carbaldehyde

Description:
2-Chloro-6-ethoxyquinoline-3-carbaldehyde is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. The presence of a chloro group at the 2-position and an ethoxy group at the 6-position contributes to its unique reactivity and solubility properties. The aldehyde functional group at the 3-position makes it a potential candidate for various chemical reactions, including condensation and nucleophilic addition. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure suggests that it may exhibit biological activity, although specific biological properties would depend on further studies. Additionally, the compound's solubility in organic solvents and stability under standard laboratory conditions are important characteristics for its handling and application in research. Safety data should be consulted to ensure proper handling due to the presence of the chloro substituent, which may pose health risks.
Formula:C12H10ClNO2
InChI:InChI=1/C12H10ClNO2/c1-2-16-10-3-4-11-8(6-10)5-9(7-15)12(13)14-11/h3-7H,2H2,1H3
InChI key:BNLBYGHJJYCBEJ-UHFFFAOYSA-N
SMILES:CCOc1ccc2c(cc(C=O)c(Cl)n2)c1
Synonyms:
  • 2-Chloro-6-ethoxy-quinoline-3-carbaldehyde
  • 3-Quinolinecarboxaldehyde, 2-Chloro-6-Ethoxy-
Found 3 products.