CAS 281209-13-0
:2,6,7-trichloro-3-(trifluoromethyl)quinoxaline
Description:
2,6,7-Trichloro-3-(trifluoromethyl)quinoxaline is a synthetic organic compound characterized by its complex structure, which includes a quinoxaline core substituted with multiple halogen atoms. The presence of three chlorine atoms at the 2, 6, and 7 positions, along with a trifluoromethyl group at the 3 position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and exhibits low solubility in water, which is common for halogenated organic compounds. Its molecular structure suggests potential applications in fields such as agrochemicals or pharmaceuticals, where halogenated compounds often exhibit enhanced biological activity or stability. Additionally, the trifluoromethyl group is known to influence the lipophilicity and metabolic stability of organic molecules. Safety and handling precautions are essential due to the potential toxicity associated with halogenated compounds, and appropriate measures should be taken to minimize exposure. Overall, 2,6,7-trichloro-3-(trifluoromethyl)quinoxaline represents a class of compounds with significant chemical versatility and potential utility in various applications.
Formula:C9H2Cl3F3N2
InChI:InChI=1/C9H2Cl3F3N2/c10-3-1-5-6(2-4(3)11)17-8(12)7(16-5)9(13,14)15/h1-2H
SMILES:c1c(c(cc2c1nc(c(Cl)n2)C(F)(F)F)Cl)Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2,6,7-Trichloro-3-(trifluoromethyl)quinoxaline
CAS:2,6,7-Trichloro-3-(trifluoromethyl)quinoxalineFormula:C9H2Cl3F3N2Purity:≥95%Color and Shape: white solidMolecular weight:301.48g/mol2,6,7-Trichloro-3-(Trifluoromethyl)Quinoxaline
CAS:2,6,7-Trichloro-3-(Trifluoromethyl)Quinoxaline is a fine chemical that is used as a building block for research chemicals and speciality chemicals. It is also a versatile building block in the synthesis of complex compounds. This compound has been shown to be useful in reactions with amines and alcohols to produce esters, ethers, and nitriles. 2,6,7-Trichloro-3-(Trifluoromethyl)Quinoxaline has CAS number 281209-13-0 and can be used as an intermediate in a range of reactions.
Formula:C9H2Cl3F3N2Purity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:301.48 g/mol


