CAS 281211-22-1
:1-(2,5-dichlorophenyl)-1,3-dihydro-2H-imidazole-2-thione
Description:
1-(2,5-Dichlorophenyl)-1,3-dihydro-2H-imidazole-2-thione, identified by its CAS number 281211-22-1, is a chemical compound that features a thione functional group within an imidazole ring structure. This compound is characterized by the presence of a dichlorophenyl substituent, which contributes to its potential biological activity and chemical reactivity. The imidazole ring is a five-membered heterocyclic structure containing nitrogen atoms, which can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. The thione group, which is a sulfur analog of a ketone, can influence the compound's solubility and reactivity. This substance may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the compound. Overall, the unique structural features of this compound suggest potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C9H6Cl2N2S
InChI:InChI=1/C9H6Cl2N2S/c10-6-1-2-7(11)8(5-6)13-4-3-12-9(13)14/h1-5H,(H,12,14)
SMILES:c1cc(c(cc1Cl)n1ccnc1S)Cl
Synonyms:- 1-(2,5-dichlorophenyl)-1H-imidazole-2-thiol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(2,5-Dichloro-phenyl)-1H-imidazole-2-thiol
CAS:Formula:C9H6Cl2N2SColor and Shape:Liquid, No data available.Molecular weight:245.12
