CAS 28123-61-7

2-Chloro-N-methyl-N-(phenylmethyl)benzamide

Description:

2-Chloro-N-methyl-N-(phenylmethyl)benzamide is an organic compound characterized by its amide functional group, which is derived from benzoic acid. The presence of a chlorine atom at the second position of the benzene ring contributes to its reactivity and potential biological activity. The N-methyl and N-(phenylmethyl) substituents indicate that the nitrogen atom is bonded to both a methyl group and a phenylmethyl group, which can influence the compound's solubility and interaction with biological systems. This compound is likely to exhibit moderate polarity due to the combination of hydrophobic aromatic groups and the polar amide functional group. Its structure suggests potential applications in medicinal chemistry, possibly as a pharmaceutical intermediate or a research chemical. Additionally, the presence of the chlorine atom may impart specific pharmacological properties, making it of interest in drug design. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or environmental impact.

Formula: C₁₅H₁₄ClNO

InChI: InChI=1S/C15H14ClNO/c1-17(11-12-7-3-2-4-8-12)15(18)13-9-5-6-10-14(13)16/h2-10H,11H2,1H3

InChI key: InChIKey=SFRGSZYPRPCWGP-UHFFFAOYSA-N

SMILES: C(N(CC1=CC=CC=C1)C)(=O)C2=C(Cl)C=CC=C2

Synonyms:

• Benzamide, N-benzyl-o-chloro-N-methyl-
• Benzamide, 2-chloro-N-methyl-N-(phenylmethyl)-
• 2-Chloro-N-methyl-N-(phenylmethyl)benzamide
• o-Chloro-N-benzyl-N-methylbenzamide