CAS 28123-73-1
:5-(4-Nitrophenyl)-2-furancarboxylic acid
Description:
5-(4-Nitrophenyl)-2-furancarboxylic acid is an organic compound characterized by its furan and nitrophenyl functional groups. It features a furan ring, which is a five-membered aromatic heterocycle containing one oxygen atom, and a carboxylic acid group (-COOH) that contributes to its acidity and reactivity. The presence of the nitrophenyl group, which contains a nitro group (-NO2) attached to a phenyl ring, enhances the compound's electrophilic properties and can influence its reactivity in various chemical reactions. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its solubility characteristics can vary depending on the solvent, and it may exhibit specific optical properties due to the presence of the aromatic systems. Additionally, the compound's structure suggests potential applications in materials science and as a building block for more complex molecules. Safety and handling precautions should be observed due to the presence of the nitro group, which can pose health risks.
Formula:C11H7NO5
InChI:InChI=1S/C11H7NO5/c13-11(14)10-6-5-9(17-10)7-1-3-8(4-2-7)12(15)16/h1-6H,(H,13,14)
InChI key:InChIKey=FXZTYDPWMQBTDH-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1OC(=CC1)C2=CC=C(N(=O)=O)C=C2
Synonyms:- 5-(p-Nitrophenyl)-2-furancarboxylic acid
- 2-Furancarboxylic acid, 5-(4-nitrophenyl)-
- 5-(p-Nitrophenyl)-2-furoic acid
- 2-Furoic acid, 5-(p-nitrophenyl)-
- 5-(4-Nitrophenyl)-2-furancarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-(4-Nitrophenyl)-2-Furoic Acid
CAS:Formula:C11H7NO5Purity:96%Color and Shape:SolidMolecular weight:233.17705-(4-Nitrophenyl)furan-2-carboxylic acid
CAS:5-(4-Nitrophenyl)furan-2-carboxylic acidPurity:98%Molecular weight:233.18g/mol5-(4-Nitrophenyl)-2-furoic acid
CAS:<p>5-(4-Nitrophenyl)-2-furoic acid is a phenolic acid that has been shown to inhibit protein–protein interactions. It has been proposed as a corrosion inhibitor for metal surfaces, and it has also been used in the synthesis of vitamin B12. 5-(4-Nitrophenyl)-2-furoic acid can be detected using fluorescence resonance energy transfer (FRET) on a surface with a constant concentration, which is proportional to the intensity of fluorescence emission. This compound can also be used as an insulin resistance marker by measuring the time it takes for glucose to enter cells.</p>Formula:C11H7NO5Purity:Min. 95%Molecular weight:233.18 g/mol




