CAS 28128-28-1

8-chloro-5H-purin-6-amine

Description:

8-Chloro-5H-purin-6-amine, with the CAS number 28128-28-1, is a purine derivative characterized by the presence of a chlorine atom at the 8-position and an amino group at the 6-position of the purine ring. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and dimethyl sulfoxide (DMSO). It exhibits properties typical of purine analogs, including potential biological activity, which may involve interactions with nucleic acid metabolism or enzyme inhibition. The presence of the chlorine atom can influence its reactivity and biological properties, making it of interest in medicinal chemistry and pharmaceutical research. Additionally, its structural features may allow it to act as a substrate or inhibitor in various biochemical pathways. As with many purine derivatives, it may also exhibit potential as an antiviral or anticancer agent, although specific biological activities would depend on further empirical studies. Proper handling and storage conditions should be observed due to its chemical nature.

Formula: C₅H₄ClN₅

InChI: InChI=1/C5H4ClN5/c6-5-10-2-3(7)8-1-9-4(2)11-5/h1-2H,(H2,7,8,9,10,11)

SMILES: C1=NC(=N)C2C(=N1)NC(=N2)Cl

Synonyms:

• 8-chloro-7H-purin-6-amine
• 8-chloro-9H-purin-6-amine
• 8-Chloroadenine
• 9H-purin-6-amine, 8-chloro-

8-chloro-9H-Purin-6-amine

CAS: 28128-28-1

Formula: C₅H₄ClN₅

Color and Shape: Solid

Molecular weight: 169.5718

Ref: IN-DA00BDZF

8-Chloroadenine

CAS: 28128-28-1

8-Chloroadenine is an antimicrobial agent that inhibits the DNA replication of bacteria by binding to the dna template. It is a potent inhibitor of oxidative DNA damage and has been shown to be effective against various bacteria, including Staphylococcus aureus. 8-Chloroadenine also has reactive properties and can react with chloride in the environment to form hypochlorous acid (HOCl) and 8-chloroguanine. This compound may also act as an enzyme catalyst for the enzymatic reaction between hypochlorous acid and chloride ions.

Formula: C₅H₄ClN₅

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 169.57 g/mol

Ref: 3D-FC09245