CAS 28128-41-8

2,8-diamino-3,5-dihydro-6H-purin-6-one

Description:

2,8-Diamino-3,5-dihydro-6H-purin-6-one, also known as a derivative of purine, is a heterocyclic organic compound characterized by its bicyclic structure that includes two fused rings containing nitrogen atoms. This compound features two amino groups at the 2 and 8 positions and a carbonyl group at the 6 position, contributing to its reactivity and potential biological activity. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, which facilitates its use in various biochemical applications. The presence of amino groups makes it a potential candidate for interactions with biological macromolecules, such as nucleic acids and proteins. This compound is of interest in medicinal chemistry and biochemistry, particularly in the study of purine metabolism and the development of pharmaceuticals targeting purine-related pathways. Its CAS number, 28128-41-8, is a unique identifier that aids in the cataloging and retrieval of information regarding this specific chemical substance.

Formula: C₅H₆N₆O

InChI: InChI=1/C5H6N6O/c6-4-8-1-2(9-4)10-5(7)11-3(1)12/h1H,(H5,6,7,8,9,10,11,12)

SMILES: C12C(=NC(=N)N2)NC(=N)N=C1O

8-Aminoguanine

Controlled Product

CAS: 28128-41-8

Formula: C₅H₆N₆O

Color and Shape: Neat

Molecular weight: 166.14

Ref: TR-A609860

8-Aminoguanine-13C2,15N

Controlled Product

CAS: 28128-41-8

Formula: C₃₁₃C₂H₆N₅₁₅NO

Color and Shape: Neat

Molecular weight: 169.12

Ref: TR-A609862

8-Aminoguanine

CAS: 28128-41-8

8-Aminoguanine is an anti-cancer agent that is used to treat leukemia. It is a hydrophobic molecule with a redox potential of −0.20 V and has been shown to inhibit the enzyme ribonucleotide reductase in vitro and in vivo. 8-Aminoguanine inhibits the production of guanine nucleotides, which are necessary for DNA synthesis and cell division. This drug also has angiogenic properties, which may be due to its ability to stimulate the formation of new blood vessels by increasing nitric oxide synthase activity. 8-Aminoguanine has also been shown to improve congestive heart failure by reducing myocardial fibrosis and ventricular hypertrophy through activation of the glycosidic bond cleavage system.

Formula: C₅H₆N₆O

Purity: Min. 95%

Color and Shape: Off-White Powder

Molecular weight: 166.14 g/mol

Ref: 3D-FA05166