CAS 28139-02-8

3-methyl-2-thioxo-1,2,3,7-tetrahydro-6H-purin-6-one

Description:

3-Methyl-2-thioxo-1,2,3,7-tetrahydro-6H-purin-6-one, with the CAS number 28139-02-8, is a purine derivative characterized by its unique structural features, including a thioxo group and a methyl substituent. This compound belongs to a class of heterocyclic compounds, which are known for their diverse biological activities. The presence of the thioxo group contributes to its potential reactivity and interaction with biological systems. Typically, purine derivatives are involved in various biochemical processes, including nucleic acid metabolism and enzyme activity modulation. The tetrahydro structure indicates that it has a saturated ring system, which may influence its solubility and stability. Additionally, the methyl group can affect the compound's lipophilicity and biological activity. Overall, 3-methyl-2-thioxo-1,2,3,7-tetrahydro-6H-purin-6-one is of interest in medicinal chemistry and pharmacology, potentially serving as a lead compound for drug development or as a biochemical probe in research.

Formula: C₆H₆N₄OS

InChI: InChI=1/C6H6N4OS/c1-10-4-3(7-2-8-4)5(11)9-6(10)12/h2H,1H3,(H,7,8)(H,9,11,12)

SMILES: Cn1c2c(c(nc1=S)O)nc[nH]2

2,3-Dihydro-2-thioxo-3-methyl-7H-purin-6(1H)-one

CAS: 28139-02-8

Formula: C₆H₆N₄OS

Purity: 95%

Color and Shape: Solid

Molecular weight: 182.2030

Ref: IN-DA00BQTU

2-Mercapto-3-methyl-3H-purin-6(9H)-one

CAS: 28139-02-8

2-Mercapto-3-methyl-3H-purin-6(9H)-one

Purity: 95%

Molecular weight: 182.21g/mol

Ref: 54-OR1075156

2-Mercapto-3-methyl-3H-purin-6(9H)-one

CAS: 28139-02-8

Purity: 97.0%

Molecular weight: 182.1999969482422

Ref: 10-F511599

2-Mercapto-3-methyl-3H-purin-6(9H)-one

CAS: 28139-02-8

2-Mercapto-3-methyl-3H-purin-6(9H)one (2MMPD) is a purine analogue that has been used as a stabilizer in the synthesis of 3-methylxanthine. It has been shown to be useful for the fragmentation of large molecules in mass spectrometry and also has spectral properties similar to those of purines. The 2MMPD molecule can be used to identify other analogues, such as 3,7-dimethylxanthine, which are otherwise difficult to distinguish from one another. Spectral data for 2MMPD has been obtained from both gas chromatography and high performance liquid chromatography.

Formula: C₆H₆N₄OS

Purity: Min. 95%

Molecular weight: 182.2 g/mol

Ref: 3D-DBA13902