CAS 28144-25-4
:Uridine-5-oxyacetic acid
Description:
Uridine-5-oxyacetic acid, identified by its CAS number 28144-25-4, is a nucleoside derivative characterized by the presence of a uridine base linked to an oxyacetic acid moiety. This compound features a ribose sugar, which is part of the nucleoside structure, and an additional carboxylic acid functional group that contributes to its chemical reactivity and solubility in polar solvents. Uridine-5-oxyacetic acid is known for its potential biological activities, including roles in cellular metabolism and signaling pathways. Its structural characteristics allow it to participate in various biochemical processes, making it of interest in pharmacological and biochemical research. The compound is typically stable under standard laboratory conditions, although it may be sensitive to extreme pH levels or prolonged exposure to light. As with many nucleoside derivatives, it may exhibit specific interactions with enzymes or receptors, which can be explored for therapeutic applications. Overall, Uridine-5-oxyacetic acid represents a significant compound in the study of nucleoside chemistry and its biological implications.
Formula:C11H14N2O9
InChI:InChI=1S/C11H14N2O9/c14-2-5-7(17)8(18)10(22-5)13-1-4(21-3-6(15)16)9(19)12-11(13)20/h1,5,7-8,10,14,17-18H,2-3H2,(H,15,16)(H,12,19,20)/t5-,7-,8-,10-/m1/s1
InChI key:InChIKey=RVCNQQGZJWVLIP-VPCXQMTMSA-N
SMILES:O[C@H]1[C@@H](O[C@H](CO)[C@H]1O)N2C=C(OCC(O)=O)C(=O)NC2=O
Synonyms:- Uridine-5-oxyacetic acid
- Acetic acid, [(1,2,3,4-tetrahydro-2,4-dioxo-1-β-D-ribofuranosyl-5-pyrimidinyl)oxy]-
- Uridine, 5-(carboxymethoxy)-
- 2-[(1,2,3,4-Tetrahydro-2,4-dioxo-1-β-D-ribofuranosyl-5-pyrimidinyl)oxy]acetic acid
- Acetic acid, 2-[(1,2,3,4-tetrahydro-2,4-dioxo-1-β-D-ribofuranosyl-5-pyrimidinyl)oxy]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Uridine 5-oxyacetic acid
CAS:Uridine 5-oxyacetic acid is a Nucleoside Derivative - 5-Modified pyrimidine nucleoside; Naturally modified ribo-nucleoside.Formula:C11H14N2O9Color and Shape:SolidMolecular weight:318.24Ref: TM-TNU0421
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquireUridine-5-oxyacetic acid
CAS:Uridine-5-oxyacetic acid is a molecule that is synthesized from uridine and 5-oxo-4-pyrone. It is an intermediate in the synthesis of pyrimidine nucleotides, which are important for DNA replication, repair, and transcription. Uridine-5-oxyacetic acid has been shown to form stable complexes with subtilisin. These complexes have been determined by X-ray crystallography to be glycosidic bond between the uridine and the enzyme. The enzymatic activity of subtilisin can be inhibited by these complexes, which may lead to frameshifting during bacterial translation. This inhibition leads to a less efficient protein synthesis process and a decrease in the production of gene products.
Formula:C11H14N2O9Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:318.24 g/mol

